The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(5-(7-chloro-2,3-dihydrobenzo[b][1,4]dioxin-6-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl)-2-fluorophenyl)-1-phenylmethanesulfonamide ID: ALA4868537
PubChem CID: 146302471
Max Phase: Preclinical
Molecular Formula: C29H21ClFN3O5S
Molecular Weight: 578.02
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cccc(NS(=O)(=O)Cc2ccccc2)c1F)c1c[nH]c2ncc(-c3cc4c(cc3Cl)OCCO4)cc12
Standard InChI: InChI=1S/C29H21ClFN3O5S/c30-23-13-26-25(38-9-10-39-26)12-20(23)18-11-21-22(15-33-29(21)32-14-18)28(35)19-7-4-8-24(27(19)31)34-40(36,37)16-17-5-2-1-3-6-17/h1-8,11-15,34H,9-10,16H2,(H,32,33)
Standard InChI Key: MATCUWKEZMKGMP-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
22.8061 -3.3318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8103 -4.1564 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.5224 -3.7405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8283 -4.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8272 -5.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5416 -5.7542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5398 -4.1019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2548 -4.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2597 -5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0469 -5.5876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.5285 -4.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0390 -4.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1141 -4.1025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1173 -3.2768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4057 -4.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2893 -3.4654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0948 -3.2892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7339 -2.8558 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6468 -3.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4516 -3.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7026 -2.9369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1423 -2.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3395 -2.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0067 -4.3331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.3675 -4.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4034 -2.8606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3951 -4.6843 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.1158 -5.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6917 -4.1062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6903 -3.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9782 -2.8708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2631 -3.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2645 -4.1087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9811 -4.5226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8331 -2.8674 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.3096 -5.7278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0579 -6.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6125 -7.1243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4187 -6.9494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6704 -6.1637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
4 13 1 0
13 14 2 0
14 26 1 0
29 15 2 0
15 13 1 0
12 16 1 0
16 17 1 0
16 18 2 0
17 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 17 1 0
20 24 1 0
24 2 1 0
2 25 1 0
30 26 2 0
19 27 1 0
25 28 1 0
29 30 1 0
29 34 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
14 35 1 0
28 36 1 0
28 40 2 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 578.02Molecular Weight (Monoisotopic): 577.0874AlogP: 5.97#Rotatable Bonds: 7Polar Surface Area: 110.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.57CX Basic pKa: 1.41CX LogP: 4.84CX LogD: 4.81Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.23Np Likeness Score: -1.11
References 1. Klövekorn P, Pfaffenrot B, Juchum M, Selig R, Albrecht W, Zender L, Laufer SA.. (2021) From off-to on-target: New BRAF-inhibitor-template-derived compounds selectively targeting mitogen activated protein kinase kinase 4 (MKK4)., 210 [PMID:33199152 ] [10.1016/j.ejmech.2020.112963 ]