N-(3-(2-Aminophenyl)-3-oxopropyl)-4-chlorobenzimidamide

ID: ALA4868558

PubChem CID: 164621882

Max Phase: Preclinical

Molecular Formula: C16H16ClN3O

Molecular Weight: 301.78

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N=C(NCCC(=O)c1ccccc1N)c1ccc(Cl)cc1

Standard InChI:  InChI=1S/C16H16ClN3O/c17-12-7-5-11(6-8-12)16(19)20-10-9-15(21)13-3-1-2-4-14(13)18/h1-8H,9-10,18H2,(H2,19,20)

Standard InChI Key:  QMWFPPBPJWLDQO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 22  0  0  0  0  0  0  0  0999 V2000
   17.0363   -4.4457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0275   -3.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7476   -4.8472    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3336   -4.8612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6223   -4.4597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9197   -4.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9243   -5.6923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6397   -6.0939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2217   -6.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2304   -6.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5278   -7.3447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8164   -6.9431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8077   -6.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5104   -5.7104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9417   -7.3266    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.7318   -3.2134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7235   -2.3971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0109   -1.9952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3053   -2.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3172   -3.2307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0011   -1.1781    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 10 15  1  0
  7  9  1  0
  4  5  1  0
  2 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20  2  1  0
 18 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868558

    ---

Associated Targets(Human)

NOS2 Tchem Nitric oxide synthase, inducible (1636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOS1 Tchem Nitric-oxide synthase, brain (1786 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 301.78Molecular Weight (Monoisotopic): 301.0982AlogP: 3.11#Rotatable Bonds: 5
Polar Surface Area: 78.97Molecular Species: BASEHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 11.06CX LogP: 3.07CX LogD: 0.67
Aromatic Rings: 2Heavy Atoms: 21QED Weighted: 0.34Np Likeness Score: -0.62

References

1. Arias F, Franco-Montalban F, Romero M, Carrión MD, Camacho ME..  (2021)  Synthesis, bioevaluation and docking studies of new imidamide derivatives as nitric oxide synthase inhibitors.,  44  [PMID:34218000] [10.1016/j.bmc.2021.116294]

Source