The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 5-((1H-Pyrrolo-[2,3-b]pyridin-3-yl)methylene)-4-oxo-2-((4-(2,2,2-trifluoroethyl)piperazin-1-yl)amino)-4,5-dihydrofuran-3-carboxylate ID: ALA4868568
PubChem CID: 136618371
Max Phase: Phase
Molecular Formula: C21H22F3N5O4
Molecular Weight: 465.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)C1=C(NN2CCN(CC(F)(F)F)CC2)O/C(=C\c2c[nH]c3ncccc23)C1=O
Standard InChI: InChI=1S/C21H22F3N5O4/c1-2-32-20(31)16-17(30)15(10-13-11-26-18-14(13)4-3-5-25-18)33-19(16)27-29-8-6-28(7-9-29)12-21(22,23)24/h3-5,10-11,27H,2,6-9,12H2,1H3,(H,25,26)/b15-10-
Standard InChI Key: DNTVXDZWVOVLOD-GDNBJRDFSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.3533 3.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0678 3.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6553 2.6424 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6389 2.5319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6389 3.3569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9244 2.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2099 2.5318 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2099 3.3568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9244 3.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2100 0.8818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4955 1.2943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4954 2.1193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0385 0.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2180 -0.0114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1176 0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6516 -0.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4362 -0.2222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6077 0.5847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2669 -0.6789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4230 0.1609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9381 0.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7284 -0.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2435 0.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2737 1.5821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1507 -0.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7637 -0.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4282 0.6710 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.5484 -0.3376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7200 -1.1445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1069 -1.6966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3222 -1.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4803 4.0714 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.7823 2.9444 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 5 1 0
1 5 1 0
6 7 1 0
7 8 1 0
8 9 1 0
4 6 1 0
5 9 1 0
10 11 1 0
11 12 1 0
7 12 1 0
13 14 1 0
14 15 1 0
10 13 1 0
11 15 2 0
16 17 1 0
17 18 2 0
13 16 2 0
20 21 1 0
14 19 2 0
15 21 1 0
22 23 1 0
20 23 1 0
21 24 2 0
25 26 2 0
26 27 1 0
17 25 1 0
18 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
25 31 1 0
26 28 1 0
2 32 1 0
2 33 1 0
M END
Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.43Molecular Weight (Monoisotopic): 465.1624AlogP: 1.96#Rotatable Bonds: 6Polar Surface Area: 99.79Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.25CX LogP: 2.21CX LogD: 2.21Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.11
References 1. Irie T, Asami T, Sawa A, Uno Y, Taniyama C, Funakoshi Y, Masai H, Sawa M.. (2021) Discovery of AS-0141, a Potent and Selective Inhibitor of CDC7 Kinase for the Treatment of Solid Cancers., 64 (19.0): [PMID:34607435 ] [10.1021/acs.jmedchem.1c01319 ] 2. International Nonproprietary Names for Pharmaceutical Substances (INN),