1-(3-(aminomethyl)phenyl)-N-(3-((cyclopropylmethoxy)(phenyl)methyl)-5-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide

ID: ALA4868583

PubChem CID: 118356068

Max Phase: Preclinical

Molecular Formula: C29H26F4N4O2

Molecular Weight: 538.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)Nc2cc(F)cc(C(OCC3CC3)c3ccccc3)c2)c1

Standard InChI:  InChI=1S/C29H26F4N4O2/c30-22-12-21(27(39-17-18-9-10-18)20-6-2-1-3-7-20)13-23(14-22)35-28(38)25-15-26(29(31,32)33)36-37(25)24-8-4-5-19(11-24)16-34/h1-8,11-15,18,27H,9-10,16-17,34H2,(H,35,38)

Standard InChI Key:  CECISELXZFBKBA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
    2.9826  -23.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9814  -24.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6895  -25.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3991  -24.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3963  -23.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6877  -23.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1075  -25.0901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8145  -24.6804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6852  -22.6375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3391  -22.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0842  -21.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2670  -21.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0169  -22.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7846  -20.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1147  -19.9731    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.9722  -20.8086    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1998  -20.1367    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.1177  -22.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2920  -23.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7219  -21.8523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5005  -22.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6716  -22.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4493  -23.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0545  -22.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8767  -21.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0992  -21.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6233  -23.9440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0188  -24.4939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4018  -24.1926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5739  -24.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3515  -25.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9570  -24.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7795  -23.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0021  -23.6411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1928  -25.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5883  -25.8423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7915  -26.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3414  -26.6223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4790  -21.2409    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  6  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  9  1  0
 12 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 10 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 23 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 28 35  1  0
 35 36  1  0
 37 36  1  0
 38 37  1  0
 36 38  1  0
 25 39  1  0
M  END

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.55Molecular Weight (Monoisotopic): 538.1992AlogP: 6.26#Rotatable Bonds: 9
Polar Surface Area: 82.17Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.81CX Basic pKa: 9.25CX LogP: 6.04CX LogD: 4.22
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.49

References

1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS..  (2021)  Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE).,  64  (17.0): [PMID:34436898] [10.1021/acs.jmedchem.1c00511]

Source