The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-(aminomethyl)phenyl)-N-(3-((cyclopropylmethoxy)(phenyl)methyl)-5-fluorophenyl)-3-(trifluoromethyl)-1H-pyrazole-5-carboxamide ID: ALA4868583
PubChem CID: 118356068
Max Phase: Preclinical
Molecular Formula: C29H26F4N4O2
Molecular Weight: 538.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NCc1cccc(-n2nc(C(F)(F)F)cc2C(=O)Nc2cc(F)cc(C(OCC3CC3)c3ccccc3)c2)c1
Standard InChI: InChI=1S/C29H26F4N4O2/c30-22-12-21(27(39-17-18-9-10-18)20-6-2-1-3-7-20)13-23(14-22)35-28(38)25-15-26(29(31,32)33)36-37(25)24-8-4-5-19(11-24)16-34/h1-8,11-15,18,27H,9-10,16-17,34H2,(H,35,38)
Standard InChI Key: CECISELXZFBKBA-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
2.9826 -23.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9814 -24.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6895 -25.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3991 -24.6827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3963 -23.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6877 -23.4547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1075 -25.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8145 -24.6804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6852 -22.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3391 -22.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0842 -21.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2670 -21.3803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0169 -22.1583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7846 -20.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1147 -19.9731 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.9722 -20.8086 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1998 -20.1367 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1177 -22.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2920 -23.2009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7219 -21.8523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5005 -22.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6716 -22.8973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4493 -23.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0545 -22.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8767 -21.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0992 -21.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6233 -23.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0188 -24.4939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4018 -24.1926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5739 -24.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3515 -25.2382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9570 -24.6881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7795 -23.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0021 -23.6411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1928 -25.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5883 -25.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7915 -26.0178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3414 -26.6223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4790 -21.2409 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
6 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 9 1 0
12 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
10 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
23 27 1 0
27 28 1 0
27 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
28 35 1 0
35 36 1 0
37 36 1 0
38 37 1 0
36 38 1 0
25 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.55Molecular Weight (Monoisotopic): 538.1992AlogP: 6.26#Rotatable Bonds: 9Polar Surface Area: 82.17Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.81CX Basic pKa: 9.25CX LogP: 6.04CX LogD: 4.22Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -1.49
References 1. Kotian PL, Wu M, Vadlakonda S, Chintareddy V, Lu P, Juarez L, Kellogg-Yelder D, Chen X, Muppa S, Chambers-Wilson R, Davis Parker C, Williams J, Polach KJ, Zhang W, Raman K, Babu YS.. (2021) Berotralstat (BCX7353): Structure-Guided Design of a Potent, Selective, and Oral Plasma Kallikrein Inhibitor to Prevent Attacks of Hereditary Angioedema (HAE)., 64 (17.0): [PMID:34436898 ] [10.1021/acs.jmedchem.1c00511 ]