N-(3-(2-Amino-5-methoxyphenyl)-3-oxopropyl)-4-chlorobenzimidamide

ID: ALA4868600

PubChem CID: 164622839

Max Phase: Preclinical

Molecular Formula: C17H18ClN3O2

Molecular Weight: 331.80

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(N)c(C(=O)CCNC(=N)c2ccc(Cl)cc2)c1

Standard InChI:  InChI=1S/C17H18ClN3O2/c1-23-13-6-7-15(19)14(10-13)16(22)8-9-21-17(20)11-2-4-12(18)5-3-11/h2-7,10H,8-9,19H2,1H3,(H2,20,21)

Standard InChI Key:  SFCDYSPXFWZQRF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
   26.9210  -12.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9123  -11.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6323  -12.7014    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.2184  -12.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.5070  -12.3138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8044  -12.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8090  -13.5464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5245  -13.9480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1064  -13.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1151  -14.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4125  -15.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7012  -14.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6925  -13.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3951  -13.5646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8264  -15.1807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.9835  -13.5778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.2802  -13.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6166  -11.0675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6082  -10.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8957   -9.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1901  -10.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2019  -11.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8859   -9.0322    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
 10 15  1  0
  7  9  1  0
  4  5  1  0
 16 17  1  0
 13 16  1  0
  2 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22  2  1  0
 20 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868600

    ---

Associated Targets(Human)

NOS2 Tchem Nitric oxide synthase, inducible (1636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOS1 Tchem Nitric-oxide synthase, brain (1786 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 331.80Molecular Weight (Monoisotopic): 331.1088AlogP: 3.12#Rotatable Bonds: 6
Polar Surface Area: 88.20Molecular Species: BASEHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 11.06CX LogP: 2.91CX LogD: 0.52
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.33Np Likeness Score: -0.67

References

1. Arias F, Franco-Montalban F, Romero M, Carrión MD, Camacho ME..  (2021)  Synthesis, bioevaluation and docking studies of new imidamide derivatives as nitric oxide synthase inhibitors.,  44  [PMID:34218000] [10.1016/j.bmc.2021.116294]

Source