The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-3-([1,1'-biphenyl]-4-yl)-2-((S)-2-((S)-2-aminopropanamido)-3-(1H-indol-3-yl)propanamido)propanamido)-6-guanidinohexanamide ID: ALA4868727
PubChem CID: 164618472
Max Phase: Preclinical
Molecular Formula: C36H45N9O4
Molecular Weight: 667.81
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccc(-c2ccccc2)cc1)C(=O)N[C@@H](CCCCNC(=N)N)C(N)=O
Standard InChI: InChI=1S/C36H45N9O4/c1-22(37)33(47)44-31(20-26-21-42-28-12-6-5-11-27(26)28)35(49)45-30(19-23-14-16-25(17-15-23)24-9-3-2-4-10-24)34(48)43-29(32(38)46)13-7-8-18-41-36(39)40/h2-6,9-12,14-17,21-22,29-31,42H,7-8,13,18-20,37H2,1H3,(H2,38,46)(H,43,48)(H,44,47)(H,45,49)(H4,39,40,41)/t22-,29-,30-,31-/m0/s1
Standard InChI Key: MJQMJOFZABKYKJ-RHFBVIABSA-N
Molfile:
RDKit 2D
49 52 0 0 0 0 0 0 0 0999 V2000
5.9088 -7.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9076 -8.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6157 -8.9629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3253 -8.5535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3225 -7.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6139 -7.3255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0337 -8.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0301 -9.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7376 -10.1859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4457 -9.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4418 -8.9547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7337 -8.5510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2010 -7.3260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2008 -6.5088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4930 -6.1003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9084 -6.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6162 -6.5084 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3238 -6.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0316 -6.5081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7392 -6.0993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0318 -7.3253 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9082 -5.2828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7854 -6.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0775 -6.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7856 -7.3263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3699 -6.5094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6621 -6.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9545 -6.5098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6619 -5.2838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0774 -5.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7850 -4.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5338 -5.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0804 -4.6049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8724 -4.0674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6732 -3.8991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9264 -3.1228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3796 -2.5142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5765 -2.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3272 -3.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3236 -5.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0312 -4.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0310 -4.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7386 -3.6478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7384 -2.8306 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4460 -2.4218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4458 -1.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1538 -2.8302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2467 -6.1014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9547 -7.3270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 13 1 0
14 13 1 6
14 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 2 0
16 22 2 0
15 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
24 30 1 1
30 31 1 0
31 32 2 0
32 33 1 0
33 35 1 0
34 31 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
18 40 1 1
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 2 0
45 47 1 0
28 48 1 0
28 49 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.81Molecular Weight (Monoisotopic): 667.3595AlogP: 1.56#Rotatable Bonds: 17Polar Surface Area: 234.10Molecular Species: BASEHBA: 6HBD: 9#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.15CX Basic pKa: 11.80CX LogP: 1.19CX LogD: -1.58Aromatic Rings: 4Heavy Atoms: 49QED Weighted: 0.05Np Likeness Score: -0.04
References 1. Baggio C, Kulinich A, Dennys CN, Rodrigo R, Meyer K, Ethell I, Pellecchia M.. (2021) NMR-Guided Design of Potent and Selective EphA4 Agonistic Ligands., 64 (15.0): [PMID:34293864 ] [10.1021/acs.jmedchem.1c00608 ]