1-(3,5-bis(3,5-dimethylphenyl)pyridin-4-yl)piperidin-4-amine

ID: ALA4868777

PubChem CID: 164619752

Max Phase: Preclinical

Molecular Formula: C26H31N3

Molecular Weight: 385.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(C)cc(-c2cncc(-c3cc(C)cc(C)c3)c2N2CCC(N)CC2)c1

Standard InChI:  InChI=1S/C26H31N3/c1-17-9-18(2)12-21(11-17)24-15-28-16-25(22-13-19(3)10-20(4)14-22)26(24)29-7-5-23(27)6-8-29/h9-16,23H,5-8,27H2,1-4H3

Standard InChI Key:  BMJNCZVLDGKCIN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    4.0969   -5.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0958   -5.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8038   -6.3545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5135   -5.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5107   -5.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8020   -4.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2138   -4.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9233   -5.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6290   -4.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6264   -3.8914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9121   -3.4857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2094   -3.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3912   -4.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3923   -3.8994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6854   -3.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9768   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9796   -4.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6871   -5.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7980   -3.9056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5063   -3.4961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5058   -2.6825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7987   -2.2722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0904   -2.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0892   -3.5015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7994   -1.4550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9062   -2.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3381   -5.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6856   -2.6739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2734   -5.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  5  7  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
  1 13  1  0
 19 20  1  0
 19 24  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
  6 19  1  0
 22 25  1  0
 11 26  1  0
  9 27  1  0
 15 28  1  0
 17 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868777

    ---

Associated Targets(Human)

SSTR2 Tclin Somatostatin receptor 2 (1526 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KCNH2 Tclin HERG (29587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 385.56Molecular Weight (Monoisotopic): 385.2518AlogP: 5.58#Rotatable Bonds: 3
Polar Surface Area: 42.15Molecular Species: BASEHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.03CX LogP: 5.42CX LogD: 2.35
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -0.45

References

1. Ishida A, Okabe Y, Matsushita T, Sekiguchi T, Nishio T, Komagata T, Iwaki M, Miyata H, Katagi J, Naganawa A, Maruyama T, Imagawa A..  (2021)  Design, synthesis, and biological evaluation of novel somatostatin receptor subtype-2 agonists: Optimization for potency and risk mitigation of hERG and phospholipidosis.,  49  [PMID:34626901] [10.1016/j.bmc.2021.116424]

Source