((R)-piperidin-3-yl)methyl ((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)carbamate

ID: ALA4868812

PubChem CID: 164620631

Max Phase: Preclinical

Molecular Formula: C28H41N3O6S

Molecular Weight: 547.72

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC[C@@H]2CCCNC2)cc1

Standard InChI:  InChI=1S/C28H41N3O6S/c1-21(2)18-31(38(34,35)25-13-11-24(36-3)12-14-25)19-27(32)26(16-22-8-5-4-6-9-22)30-28(33)37-20-23-10-7-15-29-17-23/h4-6,8-9,11-14,21,23,26-27,29,32H,7,10,15-20H2,1-3H3,(H,30,33)/t23-,26+,27-/m1/s1

Standard InChI Key:  SGEXQIUVSGWABP-DURWQBQJSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    8.3370   -2.5465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7497   -3.2564    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.1581   -2.5440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4844   -3.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4868   -2.4248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1909   -3.6567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9039   -3.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6145   -3.6609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9063   -2.4289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6193   -2.0183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3298   -2.4353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0424   -2.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0452   -1.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3296   -0.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6200   -1.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6121   -4.4822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3276   -3.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0382   -3.6650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0358   -4.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4619   -3.6692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4545   -4.4915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1643   -4.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8741   -4.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8739   -3.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1677   -3.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6230   -5.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8058   -5.1874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0275   -5.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5821   -4.9037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5826   -5.7209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7755   -3.6526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0690   -3.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3601   -3.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6533   -3.2363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9465   -3.6394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9399   -4.4569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6463   -4.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3592   -4.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  1
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 16  1  1
  8 17  1  0
 17 18  1  0
 18 19  1  0
 18  2  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  1  0
 26 27  1  0
 26 28  1  0
 23 29  1  0
 29 30  1  0
  4 31  1  0
 31 32  1  0
 33 32  1  6
 33 34  1  0
 33 38  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868812

    ---

Associated Targets(Human)

HEK-293T (167025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pol Human immunodeficiency virus type 1 protease (9113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Human immunodeficiency virus 1 (70413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.72Molecular Weight (Monoisotopic): 547.2716AlogP: 3.04#Rotatable Bonds: 13
Polar Surface Area: 117.20Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.64CX Basic pKa: 9.97CX LogP: 3.34CX LogD: 0.86
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -0.46

References

1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y..  (2021)  Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants.,  220  [PMID:33906049] [10.1016/j.ejmech.2021.113450]

Source