The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((R)-piperidin-3-yl)methyl ((2S,3R)-3-hydroxy-4-(N-isobutyl-4-methoxyphenylsulfonamido)-1-phenylbutan-2-yl)carbamate ID: ALA4868812
PubChem CID: 164620631
Max Phase: Preclinical
Molecular Formula: C28H41N3O6S
Molecular Weight: 547.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC[C@@H]2CCCNC2)cc1
Standard InChI: InChI=1S/C28H41N3O6S/c1-21(2)18-31(38(34,35)25-13-11-24(36-3)12-14-25)19-27(32)26(16-22-8-5-4-6-9-22)30-28(33)37-20-23-10-7-15-29-17-23/h4-6,8-9,11-14,21,23,26-27,29,32H,7,10,15-20H2,1-3H3,(H,30,33)/t23-,26+,27-/m1/s1
Standard InChI Key: SGEXQIUVSGWABP-DURWQBQJSA-N
Molfile:
RDKit 2D
38 40 0 0 0 0 0 0 0 0999 V2000
8.3370 -2.5465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7497 -3.2564 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.1581 -2.5440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4844 -3.2461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4868 -2.4248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1909 -3.6567 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9039 -3.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6145 -3.6609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9063 -2.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6193 -2.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3298 -2.4353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0424 -2.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0452 -1.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3296 -0.7926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6200 -1.2008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6121 -4.4822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3276 -3.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0382 -3.6650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0358 -4.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4619 -3.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4545 -4.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1643 -4.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8741 -4.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8739 -3.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1677 -3.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6230 -5.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8058 -5.1874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0275 -5.9021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5821 -4.9037 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5826 -5.7209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7755 -3.6526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0690 -3.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3601 -3.6485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6533 -3.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9465 -3.6394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9399 -4.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6463 -4.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3592 -4.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
7 9 1 1
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 16 1 1
8 17 1 0
17 18 1 0
18 19 1 0
18 2 1 0
2 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
19 26 1 0
26 27 1 0
26 28 1 0
23 29 1 0
29 30 1 0
4 31 1 0
31 32 1 0
33 32 1 6
33 34 1 0
33 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.72Molecular Weight (Monoisotopic): 547.2716AlogP: 3.04#Rotatable Bonds: 13Polar Surface Area: 117.20Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.64CX Basic pKa: 9.97CX LogP: 3.34CX LogD: 0.86Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -0.46
References 1. Zhu M, Zhou H, Ma L, Dong B, Zhou J, Zhang G, Wang M, Wang J, Cen S, Wang Y.. (2021) Design and evaluation of novel piperidine HIV-1 protease inhibitors with potency against DRV-resistant variants., 220 [PMID:33906049 ] [10.1016/j.ejmech.2021.113450 ]