1-(cyclopropylmethyl)-5-(1H-indol-3-yl)-1H-benzo[d][1,2,3]triazole

ID: ALA4868822

PubChem CID: 164621024

Max Phase: Preclinical

Molecular Formula: C18H16N4

Molecular Weight: 288.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc2c(-c3ccc4nnn(CC5CC5)c4c3)c[nH]c2c1

Standard InChI:  InChI=1S/C18H16N4/c1-2-4-16-14(3-1)15(10-19-16)13-7-8-17-18(9-13)22(21-20-17)11-12-5-6-12/h1-4,7-10,12,19H,5-6,11H2

Standard InChI Key:  SPLOWPHDUHQFOW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 26  0  0  0  0  0  0  0  0999 V2000
   20.1560  -11.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1548  -12.1033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8629  -12.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8611  -10.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5697  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5745  -12.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3545  -12.3473    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8319  -11.6821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3468  -11.0228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5947  -10.2441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3949  -10.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2904   -8.8695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0461   -9.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0948   -8.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6400   -9.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3846   -8.9628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.2996   -8.1523    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5025   -7.9828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.0922   -9.3716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8000   -8.9632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6164   -8.9601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2080   -8.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 14  1  0
 16 19  1  0
 19 20  1  0
 21 20  1  0
 22 21  1  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4868822

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 288.35Molecular Weight (Monoisotopic): 288.1375AlogP: 3.99#Rotatable Bonds: 3
Polar Surface Area: 46.50Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.36CX LogP: 3.95CX LogD: 3.95
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.62Np Likeness Score: -1.14

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source