The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-((1H-benzo[d]imidazole-2-yl)methyl)-2,4-dimethoxy-N-(4-(phenyldiazenyl)phenyl)benzenesulfonamide ID: ALA4868867
PubChem CID: 164622847
Max Phase: Preclinical
Molecular Formula: C28H25N5O4S
Molecular Weight: 527.61
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(Cc2nc3ccccc3[nH]2)c2ccc(/N=N/c3ccccc3)cc2)c(OC)c1
Standard InChI: InChI=1S/C28H25N5O4S/c1-36-23-16-17-27(26(18-23)37-2)38(34,35)33(19-28-29-24-10-6-7-11-25(24)30-28)22-14-12-21(13-15-22)32-31-20-8-4-3-5-9-20/h3-18H,19H2,1-2H3,(H,29,30)/b32-31+
Standard InChI Key: NZVLKXVCYOLQNQ-QNEJGDQOSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
3.7393 -16.9381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1520 -17.6480 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.5604 -16.9357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5703 -16.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5692 -17.6503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2772 -18.0593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9869 -17.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9841 -16.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2755 -16.4219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6902 -16.4159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3995 -16.8219 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.1056 -16.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8133 -16.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5190 -16.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5164 -15.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8021 -15.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0994 -15.5985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8612 -18.0584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4457 -18.0573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7390 -17.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0332 -18.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0341 -18.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7465 -19.2805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4494 -18.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8605 -18.8756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5678 -19.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6506 -20.0975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3126 -18.9531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8590 -19.5607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4491 -20.2664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8552 -20.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6711 -20.9734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0791 -20.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6707 -19.5602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7390 -16.8309 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0313 -16.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3275 -19.2843 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6186 -18.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 18 1 0
18 2 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
18 25 1 0
25 26 1 0
26 27 2 0
27 30 1 0
29 28 1 0
28 26 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
20 35 1 0
35 36 1 0
22 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.61Molecular Weight (Monoisotopic): 527.1627AlogP: 6.39#Rotatable Bonds: 9Polar Surface Area: 109.24Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.44CX Basic pKa: 5.01CX LogP: 5.86CX LogD: 5.86Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -1.39
References 1. Giampietro L, Gallorini M, Gambacorta N, Ammazzalorso A, De Filippis B, Della Valle A, Fantacuzzi M, Maccallini C, Mollica A, Cataldi A, Nicolotti O, Amoroso R.. (2021) Synthesis, structure-activity relationships and molecular docking studies of phenyldiazenyl sulfonamides as aromatase inhibitors., 224 [PMID:34365129 ] [10.1016/j.ejmech.2021.113737 ]