The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3,5-dimethoxybenzyl)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol ID: ALA4869013
PubChem CID: 164621037
Max Phase: Preclinical
Molecular Formula: C27H29NO6
Molecular Weight: 463.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CN2CCc3cc(OC)c(O)c4c3C2Cc2cc(O)c(OC)cc2-4)cc(OC)c1
Standard InChI: InChI=1S/C27H29NO6/c1-31-18-7-15(8-19(12-18)32-2)14-28-6-5-16-11-24(34-4)27(30)26-20-13-23(33-3)22(29)10-17(20)9-21(28)25(16)26/h7-8,10-13,21,29-30H,5-6,9,14H2,1-4H3
Standard InChI Key: CCSFDJHXQZQWJZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
5.3186 -3.4627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3174 -4.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0237 -3.0538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7364 -3.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1616 -4.2859 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1628 -3.4611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4479 -3.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7353 -4.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0259 -4.6944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4416 -5.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4440 -4.6911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7322 -5.9172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0297 -5.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3284 -5.9086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3243 -6.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0274 -7.1330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7300 -6.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6064 -4.7005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6066 -3.0543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6065 -2.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0267 -7.9544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6112 -7.1323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9007 -6.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8708 -4.7032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5853 -4.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2907 -4.7154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0006 -4.3080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0063 -3.4858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2963 -3.0728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5852 -3.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7095 -4.7256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4242 -4.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2986 -2.2514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0075 -1.8408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 9 1 0
4 3 2 0
3 1 1 0
4 8 1 0
4 7 1 0
11 5 1 0
5 6 1 0
6 7 1 0
8 9 2 0
8 11 1 0
9 13 1 0
12 10 1 0
10 11 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
2 18 1 0
1 19 1 0
19 20 1 0
16 21 1 0
15 22 1 0
22 23 1 0
5 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
27 31 1 0
31 32 1 0
29 33 1 0
33 34 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 463.53Molecular Weight (Monoisotopic): 463.1995AlogP: 4.45#Rotatable Bonds: 6Polar Surface Area: 80.62Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.51CX Basic pKa: 6.23CX LogP: 4.19CX LogD: 4.16Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: 0.83
References 1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y.. (2021) Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells., 37 [PMID:33556569 ] [10.1016/j.bmcl.2021.127844 ]