6-(3,5-dimethoxybenzyl)-2,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-1,9-diol

ID: ALA4869013

PubChem CID: 164621037

Max Phase: Preclinical

Molecular Formula: C27H29NO6

Molecular Weight: 463.53

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(CN2CCc3cc(OC)c(O)c4c3C2Cc2cc(O)c(OC)cc2-4)cc(OC)c1

Standard InChI:  InChI=1S/C27H29NO6/c1-31-18-7-15(8-19(12-18)32-2)14-28-6-5-16-11-24(34-4)27(30)26-20-13-23(33-3)22(29)10-17(20)9-21(28)25(16)26/h7-8,10-13,21,29-30H,5-6,9,14H2,1-4H3

Standard InChI Key:  CCSFDJHXQZQWJZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    5.3186   -3.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3174   -4.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0237   -3.0538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7364   -3.4591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1616   -4.2859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1628   -3.4611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4479   -3.0475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7353   -4.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0259   -4.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4416   -5.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4440   -4.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7322   -5.9172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0297   -5.5082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3284   -5.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3243   -6.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0274   -7.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7300   -6.7262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6064   -4.7005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6066   -3.0543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6065   -2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0267   -7.9544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6112   -7.1323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9007   -6.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8708   -4.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5853   -4.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2907   -4.7154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0006   -4.3080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0063   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2963   -3.0728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5852   -3.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7095   -4.7256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4242   -4.3178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2986   -2.2514    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0075   -1.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  9  1  0
  4  3  2  0
  3  1  1  0
  4  8  1  0
  4  7  1  0
 11  5  1  0
  5  6  1  0
  6  7  1  0
  8  9  2  0
  8 11  1  0
  9 13  1  0
 12 10  1  0
 10 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  2 18  1  0
  1 19  1  0
 19 20  1  0
 16 21  1  0
 15 22  1  0
 22 23  1  0
  5 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 27 31  1  0
 31 32  1  0
 29 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4869013

    ---

Associated Targets(non-human)

EL4 (235 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.53Molecular Weight (Monoisotopic): 463.1995AlogP: 4.45#Rotatable Bonds: 6
Polar Surface Area: 80.62Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.51CX Basic pKa: 6.23CX LogP: 4.19CX LogD: 4.16
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.56Np Likeness Score: 0.83

References

1. Chang L, Zhang Q, Tang Y, Fang Y, Dou R, Chu Y, Xia Y, Wei Z, Chen L, Dai Y..  (2021)  Synthesis of norisoboldine derivatives and bioactivity assay for inducing the generation of regulatory T cells.,  37  [PMID:33556569] [10.1016/j.bmcl.2021.127844]

Source