4-(2-(7-(4-methylpiperazine-1-carbonyl)naphthalen-2-yl)ethylamino)quinazoline-6-carbonitrile

ID: ALA4869016

PubChem CID: 71679654

Max Phase: Preclinical

Molecular Formula: C27H26N6O

Molecular Weight: 450.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1CCN(C(=O)c2ccc3ccc(CCNc4ncnc5ccc(C#N)cc45)cc3c2)CC1

Standard InChI:  InChI=1S/C27H26N6O/c1-32-10-12-33(13-11-32)27(34)22-6-5-21-4-2-19(14-23(21)16-22)8-9-29-26-24-15-20(17-28)3-7-25(24)30-18-31-26/h2-7,14-16,18H,8-13H2,1H3,(H,29,30,31)

Standard InChI Key:  IDUSFDWGKIHLEG-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    4.2868  -16.1787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2856  -16.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9937  -17.4072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9919  -15.7698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7005  -16.1751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6993  -16.9957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4055  -17.4048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1174  -16.9977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1186  -16.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4079  -15.7635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5795  -15.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8717  -15.3623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4079  -14.9463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1156  -14.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1156  -13.7205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8233  -13.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5280  -13.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5230  -12.0902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8187  -12.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2357  -12.4986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2342  -13.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9373  -13.7192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6423  -13.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6399  -12.4957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9363  -12.0929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3505  -13.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3514  -14.5379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0578  -13.3113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7675  -13.7251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4727  -13.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4760  -12.5017    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7680  -12.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0567  -12.4992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1848  -12.0950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 11 12  3  0
  1 11  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 21  1  0
 20 18  1  0
 18 19  2  0
 19 16  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 20  2  0
 23 26  1  0
 26 27  2  0
 26 28  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 31 34  1  0
M  END

Associated Targets(Human)

CDK1 Tchem Cyclin-dependent kinase 1 (3927 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.55Molecular Weight (Monoisotopic): 450.2168AlogP: 3.70#Rotatable Bonds: 5
Polar Surface Area: 85.15Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.84CX LogP: 3.50CX LogD: 3.39
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -1.33

References

1.  (2019)  Cdk8/cdk19 selective inhibitors and their use in anti-metastatic and chemopreventive methods for cancer, 

Source