(S)-N5-((1R,3R,5S,6r)-3-hydroxybicyclo[3.1.0]hexan-6-yl)-N7,3-dimethyl-3-phenyl-2,3-dihydrobenzofuran-5,7-dicarboxamide

ID: ALA4869149

Max Phase: Preclinical

Molecular Formula: C24H26N2O4

Molecular Weight: 406.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)c1cc(C(=O)N[C@H]2[C@@H]3C[C@@H](O)C[C@@H]32)cc2c1OC[C@@]2(C)c1ccccc1

Standard InChI:  InChI=1S/C24H26N2O4/c1-24(14-6-4-3-5-7-14)12-30-21-18(23(29)25-2)8-13(9-19(21)24)22(28)26-20-16-10-15(27)11-17(16)20/h3-9,15-17,20,27H,10-12H2,1-2H3,(H,25,29)(H,26,28)/t15-,16-,17+,20+,24-/m0/s1

Standard InChI Key:  FNHHVPPSBFQMEL-HURDOVMISA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   10.1633   -7.3939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1675   -6.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4509   -6.9778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6672   -6.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3836   -6.3166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3808   -5.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6654   -5.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6629   -4.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3762   -3.8373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9472   -3.8416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9448   -3.0166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0987   -6.7280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1000   -7.5529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8126   -6.3143    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5277   -6.7257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9524   -6.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9536   -5.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1700   -5.2368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6844   -5.9030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3542   -6.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9428   -7.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4999   -8.0499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2557   -7.7096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1655   -6.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2258   -7.8439    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.5633   -5.9147    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.4444   -7.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4399   -8.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1528   -9.0421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8718   -8.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8728   -7.8059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9719   -8.1191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  1
 16  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7 17  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
  5 12  1  0
 12 13  2  0
 12 14  1  0
 15 14  1  1
 21 15  1  0
 15 20  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19  2  1  0
  2 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 21 25  1  1
 20 26  1  1
  1 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31  1  1  0
 23 32  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4869149

    ---

Associated Targets(Human)

BRD2 Tchem Bromodomain-containing protein 2 (1296 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRDT Tchem Bromodomain testis-specific protein (576 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD4 Tchem Bromodomain-containing protein 4 (13122 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BRD3 Tchem Bromodomain-containing protein 3 (1086 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Blood (2950 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.48Molecular Weight (Monoisotopic): 406.1893AlogP: 2.24#Rotatable Bonds: 4
Polar Surface Area: 87.66Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.39CX Basic pKa: CX LogP: 1.67CX LogD: 1.67
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.73Np Likeness Score: 0.29

References

1. Lucas SCC, Atkinson SJ, Chung CW, Davis R, Gordon L, Grandi P, Gray JJR, Grimes T, Phillipou A, Preston AG, Prinjha RK, Rioja I, Taylor S, Tomkinson NCO, Wall I, Watson RJ, Woolven J, Demont EH..  (2021)  Optimization of a Series of 2,3-Dihydrobenzofurans as Highly Potent, Second Bromodomain (BD2)-Selective, Bromo and Extra-Terminal Domain (BET) Inhibitors.,  64  (15.0): [PMID:34260229] [10.1021/acs.jmedchem.1c00344]

Source