The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl)-6-(5-(methylsulfonyl)indolin-1-yl)-N-(trifluoromethyl)pyrimidin-4-amine ID: ALA4869157
PubChem CID: 58074090
Max Phase: Preclinical
Molecular Formula: C24H28F3N7O3S
Molecular Weight: 551.60
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1noc(N2CCC(N(c3cc(N4CCc5cc(S(C)(=O)=O)ccc54)ncn3)C(F)(F)F)CC2)n1
Standard InChI: InChI=1S/C24H28F3N7O3S/c1-15(2)22-30-23(37-31-22)32-9-7-17(8-10-32)34(24(25,26)27)21-13-20(28-14-29-21)33-11-6-16-12-18(38(3,35)36)4-5-19(16)33/h4-5,12-15,17H,6-11H2,1-3H3
Standard InChI Key: KOHWFUOMWLTPDC-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
4.9403 -9.5174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1549 -8.7291 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3649 -8.9374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3333 -7.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9938 -9.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7248 -7.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6960 -9.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7662 -8.4527 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3838 -10.9014 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
14.9385 -7.1288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1058 -10.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2738 -9.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1514 -7.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1241 -9.6791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3450 -11.2908 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.9078 -10.6897 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.8472 -9.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0054 -8.3984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4358 -8.4259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5529 -9.7149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5899 -8.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0199 -8.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4184 -9.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1276 -7.2804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.2953 -8.4958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8628 -8.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4652 -8.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6479 -7.3109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2801 -9.6220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3771 -10.5880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1794 -10.4330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9818 -9.8727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5389 -9.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3036 -8.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5116 -8.3178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9553 -8.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1935 -9.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9188 -7.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
19 6 1 0
23 14 1 0
20 12 1 0
17 26 1 0
25 22 1 0
4 13 1 0
22 8 2 0
23 19 2 0
24 22 1 0
10 24 1 0
12 25 1 0
11 9 1 0
15 11 1 0
7 23 1 0
25 21 1 0
11 16 1 0
4 10 2 0
17 20 1 0
5 7 2 0
8 4 1 0
14 17 1 0
18 5 1 0
6 18 2 0
21 26 1 0
14 11 1 0
13 27 1 0
13 28 1 0
29 33 1 0
32 30 1 0
30 31 1 0
31 29 1 0
5 29 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
36 2 1 0
2 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 551.60Molecular Weight (Monoisotopic): 551.1926AlogP: 4.08#Rotatable Bonds: 6Polar Surface Area: 108.56Molecular Species: NEUTRALHBA: 10HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.78CX LogP: 5.85CX LogD: 5.85Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.67
References 1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K.. (2021) Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives., 41 [PMID:34010766 ] [10.1016/j.bmc.2021.116208 ]