3-Cyano-N-(2-((2-oxo-2-(((S)-1-phenylethyl)amino)ethyl)thio)benzo[d]thiazol-6-yl)-4-(pentan-2-yloxy)benzamide

ID: ALA4869347

PubChem CID: 164622367

Max Phase: Preclinical

Molecular Formula: C30H30N4O3S2

Molecular Weight: 558.73

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1C#N

Standard InChI:  InChI=1S/C30H30N4O3S2/c1-4-8-19(2)37-26-14-11-22(15-23(26)17-31)29(36)33-24-12-13-25-27(16-24)39-30(34-25)38-18-28(35)32-20(3)21-9-6-5-7-10-21/h5-7,9-16,19-20H,4,8,18H2,1-3H3,(H,32,35)(H,33,36)/t19?,20-/m0/s1

Standard InChI Key:  XSQYHNATIRQGJP-ANYOKISRSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   22.9749  -18.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9737  -18.9999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6818  -19.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3956  -18.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3927  -18.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6800  -17.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6775  -16.9461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3881  -16.5313    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.9686  -16.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1012  -16.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8118  -16.5270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.5249  -16.9377    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.2355  -16.5228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9837  -16.8538    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.3151  -15.7025    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.1180  -15.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5244  -16.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3421  -16.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7542  -15.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.3387  -14.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5224  -14.8230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5755  -15.5306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9850  -16.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8063  -16.2409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2163  -16.9553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0368  -16.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4454  -16.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0315  -15.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2123  -15.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2667  -16.2396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1036  -17.7632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5773  -16.9543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.6771  -16.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4943  -16.9442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2703  -17.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9047  -17.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7219  -17.6488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4339  -14.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8401  -14.1114    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  6
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 17  1  0
 16 15  1  0
 15 13  2  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 10 31  2  0
 23 32  2  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 34 36  1  0
 36 37  1  0
 38 39  3  0
 28 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4869347

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 558.73Molecular Weight (Monoisotopic): 558.1759AlogP: 6.96#Rotatable Bonds: 11
Polar Surface Area: 104.11Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.56CX Basic pKa: 1.07CX LogP: 6.68CX LogD: 6.68
Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: -2.05

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source