5-(3-chlorophenyl)-3-(6-methoxy-5-(4-methyl-1H-imidazol-1-yl)pyridin-2-yl)-6-methyl-5,6-dihydro-4H-1,2,4-oxadiazine

ID: ALA4869387

PubChem CID: 126599757

Max Phase: Preclinical

Molecular Formula: C20H20ClN5O2

Molecular Weight: 397.87

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1nc(C2=NOC(C)C(c3cccc(Cl)c3)N2)ccc1-n1cnc(C)c1

Standard InChI:  InChI=1S/C20H20ClN5O2/c1-12-10-26(11-22-12)17-8-7-16(23-20(17)27-3)19-24-18(13(2)28-25-19)14-5-4-6-15(21)9-14/h4-11,13,18H,1-3H3,(H,24,25)

Standard InChI Key:  LECFGJVALIEZEX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
    5.9886   -1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4543   -2.4680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4531   -3.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1612   -3.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8708   -3.2871    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8680   -2.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1594   -2.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1610   -4.5137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8686   -4.9225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7451   -3.6956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0015   -3.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4542   -3.9728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8623   -4.6809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6617   -4.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3597   -3.8867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5742   -2.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2847   -2.4636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9887   -2.0558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2808   -0.8302    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5706   -1.2396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6964   -2.4645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6916   -3.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3985   -3.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1072   -3.2821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1045   -2.4607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3971   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6961   -0.8293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8108   -2.0496    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  4  8  1  0
  8  9  1  0
  3 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
 12 15  1  0
  6 16  1  0
 16 17  1  0
 16 20  2  0
 17 18  1  0
 18  1  1  0
  1 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  1 27  1  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4869387

    ---

Associated Targets(Human)

APH1A Tbio Gamma-secretase (4915 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.87Molecular Weight (Monoisotopic): 397.1306AlogP: 3.65#Rotatable Bonds: 4
Polar Surface Area: 73.56Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.83CX LogP: 3.68CX LogD: 3.67
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: -0.93

References

1. Bursavich MG, Harrison BA, Acharya R, Costa DE, Freeman EA, Hrdlicka LA, Jin H, Kapadnis S, Moffit JS, Murphy D, Nolan SJ, Patzke H, Tang C, Van Voorhies HE, Wen M, Koenig G, Blain JF, Burnett DA..  (2021)  Discovery of the Oxadiazine FRM-024: A Potent CNS-Penetrant Gamma Secretase Modulator.,  64  (19.0): [PMID:34550687] [10.1021/acs.jmedchem.1c00904]

Source