2-(6,8-diiodo-4-oxo-3-(4-sulfamoylphenyl)-3,4-dihydroquinazolin-2-ylthio)-N-(pyridin-2-yl)acetamide

ID: ALA4869545

PubChem CID: 164622887

Max Phase: Preclinical

Molecular Formula: C21H15I2N5O4S2

Molecular Weight: 719.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NS(=O)(=O)c1ccc(-n2c(SCC(=O)Nc3ccccn3)nc3c(I)cc(I)cc3c2=O)cc1

Standard InChI:  InChI=1S/C21H15I2N5O4S2/c22-12-9-15-19(16(23)10-12)27-21(33-11-18(29)26-17-3-1-2-8-25-17)28(20(15)30)13-4-6-14(7-5-13)34(24,31)32/h1-10H,11H2,(H2,24,31,32)(H,25,26,29)

Standard InChI Key:  HJVZMLJBPGHDGJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   19.9263  -25.5929    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3390  -26.3028    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.7474  -25.5905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6668  -27.9289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6656  -28.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3737  -29.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3719  -27.5201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0805  -27.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0793  -28.7505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7894  -29.1618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5052  -28.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5064  -27.9274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.7918  -27.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9589  -27.5205    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   15.3734  -29.9746    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   16.7918  -26.6943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2134  -27.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9204  -27.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6286  -27.5289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6311  -26.7109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9194  -26.3007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2141  -26.7092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2118  -29.1631    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.0465  -26.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.9206  -28.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6272  -29.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3361  -28.7605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6249  -29.9843    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0426  -29.1711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0356  -29.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7413  -30.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4511  -29.9892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4508  -29.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7445  -28.7610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  4 14  1  0
  6 15  1  0
 13 16  2  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 12 17  1  0
 11 23  1  0
 20  2  1  0
  2 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4869545

    ---

Associated Targets(non-human)

Nfe2l2 Nuclear factor erythroid 2-related factor 2 (714 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 719.32Molecular Weight (Monoisotopic): 718.8655AlogP: 3.37#Rotatable Bonds: 6
Polar Surface Area: 137.04Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.11CX Basic pKa: 4.03CX LogP: 4.47CX LogD: 4.47
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: -2.27

References

1. Soliman AM, Mekkawy MH, Karam HM, Higgins M, Dinkova-Kostova AT, Ghorab MM..  (2021)  Novel iodinated quinazolinones bearing sulfonamide as new scaffold targeting radiation induced oxidative stress.,  42  [PMID:33811990] [10.1016/j.bmcl.2021.128002]

Source