The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-fluoro-2-(1-(2-fluorobenzyl)-5-(isoxazol-3-yl)-1H-pyrazol-3-yl)-N-(2-morpholinoethyl)pyrimidin-4-amine ID: ALA4869584
PubChem CID: 86267722
Max Phase: Preclinical
Molecular Formula: C23H23F2N7O2
Molecular Weight: 467.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Fc1ccccc1Cn1nc(-c2ncc(F)c(NCCN3CCOCC3)n2)cc1-c1ccon1
Standard InChI: InChI=1S/C23H23F2N7O2/c24-17-4-2-1-3-16(17)15-32-21(19-5-10-34-30-19)13-20(29-32)23-27-14-18(25)22(28-23)26-6-7-31-8-11-33-12-9-31/h1-5,10,13-14H,6-9,11-12,15H2,(H,26,27,28)
Standard InChI Key: ZIESGTICPXDERY-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
29.9664 -11.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9652 -12.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6733 -12.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3830 -12.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3801 -11.3710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6715 -10.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2572 -12.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2566 -13.4194 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.5960 -13.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8479 -14.6726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6652 -14.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9182 -13.8963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8241 -13.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5734 -12.8638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7562 -12.8619 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5018 -13.6385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1618 -14.1203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1448 -15.3323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8102 -16.0791 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2894 -16.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.1031 -16.6556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4353 -15.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9541 -15.2465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5838 -17.3165 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.2586 -10.9662 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
32.2478 -15.8167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.7300 -16.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5424 -16.3888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0246 -17.0485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8371 -16.9608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6944 -17.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3193 -17.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9890 -18.3680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.1766 -18.4558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 1 0
16 17 2 0
17 13 1 0
9 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
11 18 1 0
21 24 1 0
1 25 1 0
22 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
29 31 1 0
30 32 1 0
31 34 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.48Molecular Weight (Monoisotopic): 467.1881AlogP: 3.07#Rotatable Bonds: 8Polar Surface Area: 94.13Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.88CX LogP: 3.42CX LogD: 3.41Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -2.07
References 1. Rennie GR, Barden TC, Bernier SG, Carvalho A, Deming R, Germano P, Hudson C, Im GJ, Iyengar RR, Jia L, Jung J, Kim E, Lee TW, Mermerian A, Moore J, Nakai T, Perl NR, Tobin J, Zimmer DP, Renhowe PA.. (2021) Discovery of CYR715: A novel carboxylic acid-containing soluble guanylate cyclase stimulator., 40 [PMID:33662540 ] [10.1016/j.bmcl.2021.127886 ]