The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4869597
PubChem CID: 164623835
Max Phase: Preclinical
Molecular Formula: C33H44N2O5
Molecular Weight: 548.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OCCCCC(=O)N3CCN(C)CC3)ccc21
Standard InChI: InChI=1S/C33H44N2O5/c1-32(2)21-27(25-12-10-23(37-6)19-29(25)39-32)28-22-33(3,4)40-30-20-24(11-13-26(28)30)38-18-8-7-9-31(36)35-16-14-34(5)15-17-35/h10-13,19-20H,7-9,14-18,21-22H2,1-6H3/b28-27+
Standard InChI Key: UDRUNHYKBJJHPQ-BYYHNAKLSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
21.4998 -2.8458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2997 -2.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7157 -2.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5539 -5.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7289 -5.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1414 -6.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8733 -5.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8722 -5.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5870 -6.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5852 -4.6996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3005 -5.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2994 -5.9372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0124 -6.3502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7322 -5.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0147 -4.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0145 -3.8715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0201 -2.2225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3001 -3.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7328 -2.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7305 -3.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4363 -3.8654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1449 -3.4580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1432 -2.6371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4368 -2.2319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1574 -6.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4432 -5.9386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8568 -2.2229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.5722 -2.6337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2857 -2.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0011 -2.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7146 -2.2161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4300 -2.6268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1435 -2.2126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4320 -3.4518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.8615 -2.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5728 -2.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5750 -1.3938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.8598 -0.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1422 -1.3932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2901 -0.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 15 1 0
12 13 1 0
13 5 1 0
5 14 1 0
14 15 1 0
16 20 1 0
16 18 1 0
19 17 1 0
17 2 1 0
2 18 1 0
15 16 2 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
8 25 1 0
25 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
33 35 1 0
33 39 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.72Molecular Weight (Monoisotopic): 548.3250AlogP: 6.05#Rotatable Bonds: 7Polar Surface Area: 60.47Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.06CX LogP: 4.66CX LogD: 4.50Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.39Np Likeness Score: -0.18
References 1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A.. (2021) Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog., 50 [PMID:34469711 ] [10.1016/j.bmcl.2021.128340 ]