2,4-dichloro-N-(4-(N-thiazol-2-ylsulfamoyl)phenyl)benzamide

ID: ALA4869637

Cas Number: 307509-26-8

PubChem CID: 1177181

Max Phase: Preclinical

Molecular Formula: C16H11Cl2N3O3S2

Molecular Weight: 428.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc(Cl)cc1Cl

Standard InChI:  InChI=1S/C16H11Cl2N3O3S2/c17-10-1-6-13(14(18)9-10)15(22)20-11-2-4-12(5-3-11)26(23,24)21-16-19-7-8-25-16/h1-9H,(H,19,21)(H,20,22)

Standard InChI Key:  KNTPHJCKWPHKJW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
   19.5466   -6.1785    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.9593   -6.8883    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   20.3677   -6.1760    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.8406   -7.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8394   -8.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5475   -8.5337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2572   -8.1242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2543   -7.3016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5457   -6.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6697   -7.2962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3759   -6.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1230   -7.2133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6675   -6.6040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2562   -5.8978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4576   -6.0708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.1314   -8.5327    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.4240   -8.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7160   -8.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4247   -7.3064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0094   -8.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3018   -8.5276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3007   -9.3457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0131   -9.7547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7177   -9.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4265   -9.7517    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.5932   -9.7547    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8  2  1  0
  2 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  5 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 18  1  0
 24 25  1  0
 22 26  1  0
M  END

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 428.32Molecular Weight (Monoisotopic): 426.9619AlogP: 4.50#Rotatable Bonds: 5
Polar Surface Area: 88.16Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.77CX Basic pKa: 0.59CX LogP: 4.10CX LogD: 3.55
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.63Np Likeness Score: -2.43

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source