N-hydroxy-3-(4-isopropoxybenzamido)-4-methoxybenzamide

ID: ALA4869825

PubChem CID: 164624269

Max Phase: Preclinical

Molecular Formula: C18H20N2O5

Molecular Weight: 344.37

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(C(=O)NO)cc1NC(=O)c1ccc(OC(C)C)cc1

Standard InChI:  InChI=1S/C18H20N2O5/c1-11(2)25-14-7-4-12(5-8-14)17(21)19-15-10-13(18(22)20-23)6-9-16(15)24-3/h4-11,23H,1-3H3,(H,19,21)(H,20,22)

Standard InChI Key:  XCRRMDGVURVBFB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   14.6857  -21.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6845  -22.5392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3993  -22.9521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1157  -22.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1128  -21.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3975  -21.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8258  -21.2930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5417  -21.7028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8226  -20.4680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2547  -21.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9690  -21.7009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6814  -21.2864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6788  -20.4605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9578  -20.0509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2483  -20.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3973  -21.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3999  -22.5215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1103  -21.2817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8262  -21.6918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9697  -22.9511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2556  -22.5381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5307  -20.0608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.5244  -19.2358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2562  -21.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5408  -22.9500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  7  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 12 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
  2 20  1  0
 20 21  1  0
 15 22  1  0
 22 23  1  0
 21 24  1  0
 21 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4869825

    ---

Associated Targets(Human)

HEK293 (82097 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

HDAC8 Histone deacetylase 8 (483 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Schistosoma mansoni (6170 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 344.37Molecular Weight (Monoisotopic): 344.1372AlogP: 2.85#Rotatable Bonds: 6
Polar Surface Area: 96.89Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.20CX Basic pKa: CX LogP: 2.37CX LogD: 2.36
Aromatic Rings: 2Heavy Atoms: 25QED Weighted: 0.55Np Likeness Score: -1.17

References

1. Ghazy E, Heimburg T, Lancelot J, Zeyen P, Schmidtkunz K, Truhn A, Darwish S, Simoben CV, Shaik TB, Erdmann F, Schmidt M, Robaa D, Romier C, Jung M, Pierce R, Sippl W..  (2021)  Synthesis, structure-activity relationships, cocrystallization and cellular characterization of novel smHDAC8 inhibitors for the treatment of schistosomiasis.,  225  [PMID:34392190] [10.1016/j.ejmech.2021.113745]

Source