3-methyl-N-(2-(2-oxo-2-((S)-1-phenylethylamino)ethylthio)benzo[d]thiazol-6-yl)-4-((R)-pentan-2-yloxy)benzamide

ID: ALA4869871

PubChem CID: 164625213

Max Phase: Preclinical

Molecular Formula: C30H33N3O3S2

Molecular Weight: 547.75

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC[C@@H](C)Oc1ccc(C(=O)Nc2ccc3nc(SCC(=O)N[C@@H](C)c4ccccc4)sc3c2)cc1C

Standard InChI:  InChI=1S/C30H33N3O3S2/c1-5-9-20(3)36-26-15-12-23(16-19(26)2)29(35)32-24-13-14-25-27(17-24)38-30(33-25)37-18-28(34)31-21(4)22-10-7-6-8-11-22/h6-8,10-17,20-21H,5,9,18H2,1-4H3,(H,31,34)(H,32,35)/t20-,21+/m1/s1

Standard InChI Key:  NJQONGHAIYGHFF-RTWAWAEBSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   11.2642   -6.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9759   -6.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0808   -6.7021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8495   -8.2218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7141   -6.9971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7687   -5.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7177   -9.4562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9517   -7.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3170   -7.4143    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.9498   -5.9955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4921   -5.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7726   -7.4149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7250   -7.3122    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0007   -6.6994    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3142   -5.9930    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6312   -5.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7194   -8.6345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8573   -5.9921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2671   -7.3975    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   14.5437   -6.7014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4080   -5.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1709   -5.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4470   -5.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8459   -7.4038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5547   -6.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1333   -6.9907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0547   -6.1655    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0798   -5.2800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9993   -5.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7215   -6.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1361   -8.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1403   -9.4595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4245   -7.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2610   -5.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4240   -8.2283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2239   -5.9902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4267   -9.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1825   -6.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6 22  1  0
 30 20  1  0
  3 11  2  0
 38 14  1  0
 12 38  2  0
 17  7  2  0
 35 33  1  0
 15 30  1  0
 31 35  2  0
  8 12  1  0
 19  2  1  0
 13  1  1  0
 11 15  1  0
 24 25  1  0
  7 37  1  0
 33 26  1  0
 16 23  1  0
 10 20  1  0
 14 21  1  0
 36 16  1  0
 30  9  2  0
 32 31  1  0
 35 17  1  0
 26 24  1  0
 18  1  2  0
 21 29  1  6
  1  3  1  0
 38  6  1  0
 37 32  2  0
 24  4  2  0
 33  5  1  6
  6 10  2  0
 11 28  1  0
 27  2  2  0
  2 13  1  0
 28 34  2  0
 18 27  1  0
 34 18  1  0
 21 36  1  0
 25 19  1  0
 20  8  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4869871

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 547.75Molecular Weight (Monoisotopic): 547.1963AlogP: 7.39#Rotatable Bonds: 11
Polar Surface Area: 80.32Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.64CX Basic pKa: 1.07CX LogP: 7.34CX LogD: 7.34
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.19Np Likeness Score: -1.93

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source