The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1-((5-(3,5-Dichlorophenoxy)pyridin-3-yl)methyl)piperidin-4-yl)-5-methylpyrimidine-2,4(1H,3H)-dione ID: ALA4869914
PubChem CID: 164618942
Max Phase: Preclinical
Molecular Formula: C22H22Cl2N4O3
Molecular Weight: 461.35
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cn(C2CCN(Cc3cncc(Oc4cc(Cl)cc(Cl)c4)c3)CC2)c(=O)[nH]c1=O
Standard InChI: InChI=1S/C22H22Cl2N4O3/c1-14-12-28(22(30)26-21(14)29)18-2-4-27(5-3-18)13-15-6-20(11-25-10-15)31-19-8-16(23)7-17(24)9-19/h6-12,18H,2-5,13H2,1H3,(H,26,29,30)
Standard InChI Key: IGCBWQMHMMBBRM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
14.5553 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5542 -3.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2622 -3.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9719 -3.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9690 -2.6172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2604 -2.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6802 -3.8473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.3873 -3.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0959 -3.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8025 -3.4385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8016 -2.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0883 -2.2132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3846 -2.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.5106 -3.8464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2179 -3.4370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.9253 -3.8501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6305 -3.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6338 -2.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9258 -2.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2145 -2.6242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3426 -2.2200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.0484 -2.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7551 -2.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7615 -1.4140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0551 -1.0013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3422 -1.4062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4601 -2.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4718 -1.0100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6358 -0.9952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8461 -3.8483 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.2580 -1.3947 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
10 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 1 0
21 26 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 1 0
23 27 1 0
24 28 2 0
26 29 2 0
2 30 1 0
6 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.35Molecular Weight (Monoisotopic): 460.1069AlogP: 4.18#Rotatable Bonds: 5Polar Surface Area: 80.22Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.31CX Basic pKa: 7.25CX LogP: 3.01CX LogD: 2.77Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.62Np Likeness Score: -1.06
References 1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S.. (2021) Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors., 225 [PMID:34450493 ] [10.1016/j.ejmech.2021.113784 ]