The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(5-carbamoyl-1-(4-(5-carbamoyl-2-(3-carboxypropanoyl)-7-(3-morpholinopropoxy)-1H-benzo[d]imidazol-1-yl)but-2-enyl)-7-methoxy-1H-benzo[d]imidazol-2-yl)-4-oxobutanoic acid ID: ALA4870056
PubChem CID: 164622906
Max Phase: Preclinical
Molecular Formula: C36H41N7O11
Molecular Weight: 747.76
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(N)=O)cc2nc(C(=O)CCC(=O)O)n(C/C=C/Cn3c(C(=O)CCC(=O)O)nc4cc(C(N)=O)cc(OCCCN5CCOCC5)c43)c12
Standard InChI: InChI=1S/C36H41N7O11/c1-52-27-19-21(33(37)50)17-23-31(27)42(35(39-23)25(44)5-7-29(46)47)10-2-3-11-43-32-24(40-36(43)26(45)6-8-30(48)49)18-22(34(38)51)20-28(32)54-14-4-9-41-12-15-53-16-13-41/h2-3,17-20H,4-16H2,1H3,(H2,37,50)(H2,38,51)(H,46,47)(H,48,49)/b3-2+
Standard InChI Key: QAHDADNVANEXQC-NSCUHMNNSA-N
Molfile:
RDKit 2D
54 58 0 0 0 0 0 0 0 0999 V2000
30.8817 -4.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8806 -4.9356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3089 -4.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5935 -3.6955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3118 -4.9352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6005 -5.3489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7741 -6.1532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5929 -6.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9250 -5.4838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0077 -6.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5975 -7.6655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0123 -8.3786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1644 -3.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1642 -2.8724 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4500 -4.1101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0218 -3.6895 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0187 -2.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7313 -5.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2854 -5.9209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0918 -5.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6458 -6.3580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4523 -6.1839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.0655 -6.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7786 -6.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7837 -5.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6003 -5.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0814 -4.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7469 -4.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9267 -4.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4493 -4.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.6286 -4.5988 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2900 -3.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7722 -3.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4336 -2.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9159 -1.7554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.7402 -1.8447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2219 -1.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8871 -0.4250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.0655 -0.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5788 -1.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2316 -3.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0522 -3.5145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.8941 -2.6777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9823 -7.5523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6515 -8.0348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5682 -8.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8327 -6.9470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.2298 -7.8907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.2374 -9.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1542 -10.1589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9899 -8.9998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6021 -9.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0170 -9.8076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.7771 -9.0971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 6 1 0
5 3 1 0
3 4 2 0
4 1 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
13 14 1 0
13 15 2 0
1 13 1 0
3 16 1 0
16 17 1 0
9 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 26 1 0
25 22 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
41 42 1 0
41 43 2 0
28 41 1 0
23 44 1 0
44 45 1 0
45 46 1 0
10 47 2 0
44 48 2 0
46 49 1 0
49 50 1 0
49 51 2 0
12 52 1 0
52 53 1 0
52 54 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 747.76Molecular Weight (Monoisotopic): 747.2864AlogP: 2.04#Rotatable Bonds: 20Polar Surface Area: 261.49Molecular Species: ACIDHBA: 14HBD: 4#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 3.42CX Basic pKa: 6.37CX LogP: -3.06CX LogD: -6.55Aromatic Rings: 4Heavy Atoms: 54QED Weighted: 0.06Np Likeness Score: -0.56
References 1. Song Z, Wang X, Zhang Y, Gu W, Shen A, Ding C, Li H, Xiao R, Geng M, Xie Z, Zhang A.. (2021) Structure-Activity Relationship Study of Amidobenzimidazole Analogues Leading to Potent and Systemically Administrable Stimulator of Interferon Gene (STING) Agonists., 64 (3.0): [PMID:33470814 ] [10.1021/acs.jmedchem.0c01900 ]