The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2,4-dimethoxy-N-(2-(2-(1-(4-methoxyphenyl)ethylamino)-2-oxoethoxy)benzo[d]thiazol-6-yl)-3-methylbenzamide ID: ALA4870080
PubChem CID: 164623401
Max Phase: Preclinical
Molecular Formula: C28H29N3O6S
Molecular Weight: 535.62
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@H](C)NC(=O)COc2nc3ccc(NC(=O)c4ccc(OC)c(C)c4OC)cc3s2)cc1
Standard InChI: InChI=1S/C28H29N3O6S/c1-16-23(35-4)13-11-21(26(16)36-5)27(33)30-19-8-12-22-24(14-19)38-28(31-22)37-15-25(32)29-17(2)18-6-9-20(34-3)10-7-18/h6-14,17H,15H2,1-5H3,(H,29,32)(H,30,33)/t17-/m0/s1
Standard InChI Key: VWTROQZQJCJGDZ-KRWDZBQOSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
24.2579 -6.2742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0788 -4.8494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1939 -10.6980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5605 -6.2719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9062 -7.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2374 -6.8899 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
23.8476 -6.9910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9080 -9.4655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9067 -10.2879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7816 -6.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3174 -5.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4930 -5.5599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7261 -4.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7340 -6.2740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1903 -6.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5645 -5.7312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1965 -8.2208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9735 -6.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0516 -6.5611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0192 -5.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3365 -6.9785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6045 -6.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7794 -4.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4844 -6.5569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6189 -6.5653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8457 -5.5583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3227 -6.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6263 -9.0493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0844 -6.2732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3726 -5.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7692 -6.9743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4970 -6.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6235 -8.2172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3389 -7.8051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6009 -4.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9037 -6.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4869 -4.1355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1954 -9.0498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30 10 2 0
20 35 1 0
12 29 1 0
26 1 1 0
12 2 1 0
22 20 2 0
1 7 2 0
19 31 1 0
21 19 1 0
38 8 1 0
8 28 2 0
35 23 2 0
31 24 1 0
2 37 1 0
10 22 1 0
5 17 1 0
28 33 1 0
36 25 1 0
17 38 2 0
27 14 2 0
8 9 1 0
11 12 2 0
14 11 1 0
32 27 1 0
9 3 1 0
30 16 1 0
11 13 1 0
14 4 1 0
4 18 1 0
25 21 1 0
6 10 1 0
1 29 1 0
20 26 1 0
23 30 1 0
21 34 2 0
24 6 1 0
36 15 1 6
5 36 1 0
33 5 2 0
16 24 2 0
29 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.62Molecular Weight (Monoisotopic): 535.1777AlogP: 5.14#Rotatable Bonds: 10Polar Surface Area: 108.01Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 4.81CX LogD: 4.81Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.47
References 1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y.. (2021) Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors., 216 [PMID:33689932 ] [10.1016/j.ejmech.2021.113333 ]