(S)-2,4-dimethoxy-N-(2-(2-(1-(4-methoxyphenyl)ethylamino)-2-oxoethoxy)benzo[d]thiazol-6-yl)-3-methylbenzamide

ID: ALA4870080

PubChem CID: 164623401

Max Phase: Preclinical

Molecular Formula: C28H29N3O6S

Molecular Weight: 535.62

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc([C@H](C)NC(=O)COc2nc3ccc(NC(=O)c4ccc(OC)c(C)c4OC)cc3s2)cc1

Standard InChI:  InChI=1S/C28H29N3O6S/c1-16-23(35-4)13-11-21(26(16)36-5)27(33)30-19-8-12-22-24(14-19)38-28(31-22)37-15-25(32)29-17(2)18-6-9-20(34-3)10-7-18/h6-14,17H,15H2,1-5H3,(H,29,32)(H,30,33)/t17-/m0/s1

Standard InChI Key:  VWTROQZQJCJGDZ-KRWDZBQOSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   24.2579   -6.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0788   -4.8494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1939  -10.6980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5605   -6.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9062   -7.8094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2374   -6.8899    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   23.8476   -6.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9080   -9.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9067  -10.2879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7816   -6.2733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3174   -5.5557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4930   -5.5599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7261   -4.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7340   -6.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1903   -6.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5645   -5.7312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1965   -8.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9735   -6.9831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0516   -6.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0192   -5.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3365   -6.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6045   -6.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7794   -4.8462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4844   -6.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6189   -6.5653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.8457   -5.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3227   -6.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6263   -9.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0844   -6.2732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3726   -5.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7692   -6.9743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.4970   -6.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6235   -8.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3389   -7.8051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6009   -4.8431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9037   -6.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4869   -4.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1954   -9.0498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 30 10  2  0
 20 35  1  0
 12 29  1  0
 26  1  1  0
 12  2  1  0
 22 20  2  0
  1  7  2  0
 19 31  1  0
 21 19  1  0
 38  8  1  0
  8 28  2  0
 35 23  2  0
 31 24  1  0
  2 37  1  0
 10 22  1  0
  5 17  1  0
 28 33  1  0
 36 25  1  0
 17 38  2  0
 27 14  2  0
  8  9  1  0
 11 12  2  0
 14 11  1  0
 32 27  1  0
  9  3  1  0
 30 16  1  0
 11 13  1  0
 14  4  1  0
  4 18  1  0
 25 21  1  0
  6 10  1  0
  1 29  1  0
 20 26  1  0
 23 30  1  0
 21 34  2  0
 24  6  1  0
 36 15  1  6
  5 36  1  0
 33  5  2  0
 16 24  2  0
 29 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4870080

    ---

Associated Targets(Human)

STAT3 Tchem Signal transducer and activator of transcription 3 (3313 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 535.62Molecular Weight (Monoisotopic): 535.1777AlogP: 5.14#Rotatable Bonds: 10
Polar Surface Area: 108.01Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.85CX Basic pKa: CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.47

References

1. Gao D, Jin N, Fu Y, Zhu Y, Wang Y, Wang T, Chen Y, Zhang M, Xiao Q, Huang M, Li Y..  (2021)  Rational drug design of benzothiazole-based derivatives as potent signal transducer and activator of transcription 3 (STAT3) signaling pathway inhibitors.,  216  [PMID:33689932] [10.1016/j.ejmech.2021.113333]

Source