(R)-isopropyl 2-amino-5-(4-(2-(3,5-difluorophenyl)-2-hydroxyacetamido)-2-methylphenyl)nicotinate

ID: ALA4870100

PubChem CID: 156118035

Max Phase: Preclinical

Molecular Formula: C24H23F2N3O4

Molecular Weight: 455.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(NC(=O)[C@H](O)c2cc(F)cc(F)c2)ccc1-c1cnc(N)c(C(=O)OC(C)C)c1

Standard InChI:  InChI=1S/C24H23F2N3O4/c1-12(2)33-24(32)20-9-15(11-28-22(20)27)19-5-4-18(6-13(19)3)29-23(31)21(30)14-7-16(25)10-17(26)8-14/h4-12,21,30H,1-3H3,(H2,27,28)(H,29,31)/t21-/m1/s1

Standard InChI Key:  YXMQYIZUPKQHRP-OAQYLSRUSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   31.2004  -21.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1993  -22.2316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9073  -22.6405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6170  -22.2311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6142  -21.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9055  -21.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4947  -21.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4958  -20.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7889  -19.7771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0803  -20.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0831  -21.0074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7907  -21.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3719  -19.7785    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3750  -21.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6658  -21.0138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3781  -22.2369    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.6719  -22.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6750  -23.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9627  -22.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3253  -22.6386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0324  -22.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7408  -22.6364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0311  -21.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.4478  -22.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1549  -22.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8615  -22.2265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8606  -21.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.1473  -21.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.4436  -21.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4913  -22.6396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5696  -22.6343    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   36.1431  -20.1839    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.7420  -23.4535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  1  7  1  0
 10 13  1  0
 14 15  2  0
 14 16  1  0
 11 14  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  0
  4 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  2 30  1  0
 26 31  1  0
 28 32  1  0
 22 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4870100

    ---

Associated Targets(Human)

EIF2AK3 Tchem Eukaryotic translation initiation factor 2-alpha kinase 3 (635 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
EIF2S1 Tchem Eukaryotic translation initiation factor 2 subunit 1 (143 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.46Molecular Weight (Monoisotopic): 455.1657AlogP: 4.15#Rotatable Bonds: 6
Polar Surface Area: 114.54Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 12.01CX Basic pKa: 4.68CX LogP: 4.75CX LogD: 4.75
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.94

References

1. Calvo V, Surguladze D, Li AH, Surman MD, Malibhatla S, Bandaru M, Jonnalagadda SK, Adarasandi R, Velmala M, Singireddi DRP, Velpuri M, Nareddy BR, Sastry V, Mandati C, Guguloth R, Siddiqui S, Patil BS, Chad E, Wolfley J, Gasparek J, Feldman K, Betzenhauser M, Wiens B, Koszelak-Rosenblum M, Zhu G, Du H, Rigby AC, Mulvihill MJ..  (2021)  Discovery of 2-amino-3-amido-5-aryl-pyridines as highly potent, orally bioavailable, and efficacious PERK kinase inhibitors.,  43  [PMID:33895276] [10.1016/j.bmcl.2021.128058]

Source