N-(3-((1-(3,4-Dimethoxybenzyl)-1H-imidazo[4,5-c]pyridin-6-yl)amino)phenyl)acetamide

ID: ALA4870171

PubChem CID: 71729631

Max Phase: Preclinical

Molecular Formula: C23H23N5O3

Molecular Weight: 417.47

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(Cn2cnc3cnc(Nc4cccc(NC(C)=O)c4)cc32)cc1OC

Standard InChI:  InChI=1S/C23H23N5O3/c1-15(29)26-17-5-4-6-18(10-17)27-23-11-20-19(12-24-23)25-14-28(20)13-16-7-8-21(30-2)22(9-16)31-3/h4-12,14H,13H2,1-3H3,(H,24,27)(H,26,29)

Standard InChI Key:  UXZWOXAVLCZMJQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    3.3486   -4.0957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3474   -4.9232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0622   -5.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7786   -4.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7758   -4.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0604   -3.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6340   -3.6834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9197   -4.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2051   -3.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9199   -4.9211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4887   -3.6770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2047   -4.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2045   -4.9094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9196   -5.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9120   -3.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6277   -4.0746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6377   -4.9035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4292   -5.1501    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9083   -4.4736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4130   -3.8090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6584   -3.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4632   -2.8401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0191   -3.4477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8232   -3.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0693   -2.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5049   -1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7030   -2.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7475   -1.0823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5517   -0.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8738   -2.2961    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4341   -2.9017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  5 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 26 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

HL-60 (67320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.47Molecular Weight (Monoisotopic): 417.1801AlogP: 4.20#Rotatable Bonds: 7
Polar Surface Area: 90.30Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.65CX LogP: 2.95CX LogD: 2.94
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.25

References

1. Josa-Culleré L, Madden KS, Cogswell TJ, Jackson TR, Carter TS, Zhang D, Trevitt G, Davies SG, Vyas P, Wynne GM, Milne TA, Russell AJ..  (2021)  A Phenotypic Screen Identifies a Compound Series That Induces Differentiation of Acute Myeloid Leukemia Cells In Vitro and Shows Antitumor Effects In Vivo.,  64  (21.0): [PMID:34672555] [10.1021/acs.jmedchem.1c00574]

Source