N-(4-(4-Bromophenoxy)phenyl)-4-(2-((4-methoxybenzyl)-amino)-2-oxoethoxy)benzamide

ID: ALA4870349

PubChem CID: 164623856

Max Phase: Preclinical

Molecular Formula: C29H25BrN2O5

Molecular Weight: 561.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)COc2ccc(C(=O)Nc3ccc(Oc4ccc(Br)cc4)cc3)cc2)cc1

Standard InChI:  InChI=1S/C29H25BrN2O5/c1-35-24-10-2-20(3-11-24)18-31-28(33)19-36-25-12-4-21(5-13-25)29(34)32-23-8-16-27(17-9-23)37-26-14-6-22(30)7-15-26/h2-17H,18-19H2,1H3,(H,31,33)(H,32,34)

Standard InChI Key:  DWTXVJLWJMNYHV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   17.1979   -4.4931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9075   -4.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9075   -3.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1961   -2.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4911   -3.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4911   -4.0841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7836   -2.8541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7836   -2.0369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6159   -4.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3230   -4.0814    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.0313   -4.4889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7384   -4.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4467   -4.4867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.1538   -4.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8593   -4.4847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5651   -4.0757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5651   -3.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8517   -2.8503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1538   -3.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2716   -2.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2716   -2.0298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.9805   -3.2535    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.6870   -2.8429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3930   -3.2499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0971   -2.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0971   -2.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3832   -1.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6870   -2.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8031   -1.6103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5125   -2.0159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5125   -2.8365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2202   -3.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9272   -2.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9272   -2.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2119   -1.6071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6371   -3.2350    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   20.0313   -5.3061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  2  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 17 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
 33 36  1  0
 11 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4870349

    ---

Associated Targets(Human)

MEIS1 Tbio Homeobox protein Meis1 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 561.43Molecular Weight (Monoisotopic): 560.0947AlogP: 6.20#Rotatable Bonds: 10
Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.33CX Basic pKa: CX LogP: 5.64CX LogD: 5.64
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.21

References

1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M..  (2021)  Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor.,  64  (19.0): [PMID:34542289] [10.1021/acs.jmedchem.1c00972]

Source