The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-Bromophenoxy)phenyl)-4-(2-((4-methoxybenzyl)-amino)-2-oxoethoxy)benzamide ID: ALA4870349
PubChem CID: 164623856
Max Phase: Preclinical
Molecular Formula: C29H25BrN2O5
Molecular Weight: 561.43
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)COc2ccc(C(=O)Nc3ccc(Oc4ccc(Br)cc4)cc3)cc2)cc1
Standard InChI: InChI=1S/C29H25BrN2O5/c1-35-24-10-2-20(3-11-24)18-31-28(33)19-36-25-12-4-21(5-13-25)29(34)32-23-8-16-27(17-9-23)37-26-14-6-22(30)7-15-26/h2-17H,18-19H2,1H3,(H,31,33)(H,32,34)
Standard InChI Key: DWTXVJLWJMNYHV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
17.1979 -4.4931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9075 -4.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9075 -3.2610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1961 -2.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4911 -3.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4911 -4.0841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7836 -2.8541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7836 -2.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6159 -4.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3230 -4.0814 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.0313 -4.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7384 -4.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4467 -4.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.1538 -4.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8593 -4.4847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5651 -4.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5651 -3.2576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8517 -2.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1538 -3.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2716 -2.8470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2716 -2.0298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9805 -3.2535 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6870 -2.8429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3930 -3.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0971 -2.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0971 -2.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3832 -1.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6870 -2.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8031 -1.6103 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5125 -2.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5125 -2.8365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2202 -3.2420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9272 -2.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9272 -2.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2119 -1.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6371 -3.2350 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
20.0313 -5.3061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
6 5 2 0
6 1 1 0
5 7 1 0
7 8 1 0
2 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
17 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
26 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
33 36 1 0
11 37 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 561.43Molecular Weight (Monoisotopic): 560.0947AlogP: 6.20#Rotatable Bonds: 10Polar Surface Area: 85.89Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.33CX Basic pKa: ┄CX LogP: 5.64CX LogD: 5.64Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.24Np Likeness Score: -1.21
References 1. Turgutalp B, Uslu M, Helvacioglu S, Charehsaz M, Gurdal EE, Sippl W, Kocabas F, Yarim M.. (2021) Lead Optimization and Structure-Activity Relationship Studies on Myeloid Ecotropic Viral Integration Site 1 Inhibitor., 64 (19.0): [PMID:34542289 ] [10.1021/acs.jmedchem.1c00972 ]