The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-amino-4-(anthracen-9-yl)-5-oxo-4,5-dihydropyrano[3,2-c]chromene-3-carbonitrile ID: ALA4870414
PubChem CID: 164618951
Max Phase: Preclinical
Molecular Formula: C27H16N2O3
Molecular Weight: 416.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#CC1=C(N)Oc2c(c(=O)oc3ccccc23)C1c1c2ccccc2cc2ccccc12
Standard InChI: InChI=1S/C27H16N2O3/c28-14-20-23(22-17-9-3-1-7-15(17)13-16-8-2-4-10-18(16)22)24-25(32-26(20)29)19-11-5-6-12-21(19)31-27(24)30/h1-13,23H,29H2
Standard InChI Key: FXWDSWVDPYAWPI-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
15.1723 -13.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1711 -14.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8873 -14.9384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8854 -13.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6021 -13.6923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6009 -14.5269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3191 -14.9429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0431 -14.5289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3215 -13.2737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0442 -13.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7691 -13.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7775 -12.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0547 -12.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3236 -12.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0616 -11.1983 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4947 -12.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2140 -11.6373 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4802 -13.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9033 -14.5441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1830 -14.9512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4746 -14.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7599 -14.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7523 -15.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4654 -16.1760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1773 -15.7696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1959 -13.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9051 -13.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6173 -13.3067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6216 -12.4851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9077 -12.0715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1984 -12.4803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0373 -15.3531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 2 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
13 15 1 0
16 17 3 0
12 16 1 0
18 21 2 0
20 19 2 0
19 27 1 0
26 18 1 0
11 18 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 26 2 0
8 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.44Molecular Weight (Monoisotopic): 416.1161AlogP: 5.32#Rotatable Bonds: 1Polar Surface Area: 89.25Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 1.85CX LogP: 4.22CX LogD: 4.22Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.30Np Likeness Score: -0.46
References 1. Sarkate AP, Dofe VS, Tiwari SV, Lokwani DK, Karnik KS, Kamble DD, Ansari MHSH, Dodamani S, Jalalpure SS, Sangshetti JN, Azad R, Burra PVLS, Bhandari SV.. (2021) One pot synthesis, in silico study and evaluation of some novel flavonoids as potent topoisomerase II inhibitors., 40 [PMID:33689875 ] [10.1016/j.bmcl.2021.127916 ]