5-Methyl-1-(1-((6-phenoxypyridin-2-yl)methyl)piperidin-4-yl)pyrimidine-2,4(1H,3H)-dione

ID: ALA4870416

PubChem CID: 134693701

Max Phase: Preclinical

Molecular Formula: C22H24N4O3

Molecular Weight: 392.46

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(C2CCN(Cc3cccc(Oc4ccccc4)n3)CC2)c(=O)[nH]c1=O

Standard InChI:  InChI=1S/C22H24N4O3/c1-16-14-26(22(28)24-21(16)27)18-10-12-25(13-11-18)15-17-6-5-9-20(23-17)29-19-7-3-2-4-8-19/h2-9,14,18H,10-13,15H2,1H3,(H,24,27,28)

Standard InChI Key:  BKRRWLAIGUKKJX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   11.9469   -2.6744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9458   -3.4939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6538   -3.9029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3635   -3.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3606   -2.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6520   -2.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0718   -3.9010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7789   -3.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4875   -3.9012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1941   -3.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1932   -2.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4799   -2.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7762   -2.6782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9022   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6095   -3.4907    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3169   -3.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0221   -3.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0254   -2.6804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3174   -2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6061   -2.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7342   -2.2737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.4400   -2.6884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1467   -2.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1531   -1.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4467   -1.0550    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7338   -1.4598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8517   -2.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8634   -1.0637    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0274   -1.0489    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 10 14  1  0
 14 15  1  0
 15 16  1  0
 15 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 23 27  1  0
 24 28  2  0
 26 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4870416

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

tmk Thymidylate kinase (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.46Molecular Weight (Monoisotopic): 392.1848AlogP: 2.87#Rotatable Bonds: 5
Polar Surface Area: 80.22Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.31CX Basic pKa: 7.32CX LogP: 2.47CX LogD: 2.21
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.72Np Likeness Score: -1.20

References

1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S..  (2021)  Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors.,  225  [PMID:34450493] [10.1016/j.ejmech.2021.113784]

Source