7-Chloro-3-((4-hydroxy-1-(4-nitrobenzoyl)piperidin-4-yl)methyl)quinazolin-4(3H)-one

ID: ALA4870453

PubChem CID: 164618968

Max Phase: Preclinical

Molecular Formula: C21H19ClN4O5

Molecular Weight: 442.86

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccc([N+](=O)[O-])cc1)N1CCC(O)(Cn2cnc3cc(Cl)ccc3c2=O)CC1

Standard InChI:  InChI=1S/C21H19ClN4O5/c22-15-3-6-17-18(11-15)23-13-25(20(17)28)12-21(29)7-9-24(10-8-21)19(27)14-1-4-16(5-2-14)26(30)31/h1-6,11,13,29H,7-10,12H2

Standard InChI Key:  NGBRFICKYRIKFR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    0.3885  -10.2183    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.0947   -9.8070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8024  -10.2164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7912   -8.5820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0884   -8.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5054   -8.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5050   -9.8018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2059  -10.2070    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9118   -9.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9122   -8.9885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2068   -8.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2061   -7.7616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6205   -8.5810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3276   -8.9906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3206   -9.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0236  -10.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7343   -9.8126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7375   -8.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0300   -8.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5346   -8.1967    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4399  -10.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4355  -11.0422    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1497   -9.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8522  -10.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5616   -9.8327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5664   -9.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8559   -8.6025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1494   -9.0090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2797   -8.6056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2830   -7.7884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9858   -9.0170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  7  1  0
  6  4  1  0
  4  5  2  0
  5  2  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 14 19  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 20  1  0
 17 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 29 30  2  0
 29 31  1  0
 26 29  1  0
M  CHG  2  29   1  31  -1
M  END

Alternative Forms

  1. Parent:

    ALA4870453

    ---

Associated Targets(Human)

USP7 Tchem Ubiquitin carboxyl-terminal hydrolase 7 (837 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.86Molecular Weight (Monoisotopic): 442.1044AlogP: 2.63#Rotatable Bonds: 4
Polar Surface Area: 118.57Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.56CX LogP: 1.83CX LogD: 1.83
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.34

References

1. Li P, Liu Y, Yang H, Liu HM..  (2021)  Design, synthesis, biological evaluation and structure-activity relationship study of quinazolin-4(3H)-one derivatives as novel USP7 inhibitors.,  216  [PMID:33684824] [10.1016/j.ejmech.2021.113291]

Source