The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-amino-5-(4-(2-(3,5-difluorophenyl)-2-hydroxyacetamido)-2-methoxyphenyl)-N-isopropylnicotinamide ID: ALA4870565
PubChem CID: 156117988
Max Phase: Preclinical
Molecular Formula: C24H24F2N4O4
Molecular Weight: 470.48
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(NC(=O)[C@H](O)c2cc(F)cc(F)c2)ccc1-c1cnc(N)c(C(=O)NC(C)C)c1
Standard InChI: InChI=1S/C24H24F2N4O4/c1-12(2)29-23(32)19-8-14(11-28-22(19)27)18-5-4-17(10-20(18)34-3)30-24(33)21(31)13-6-15(25)9-16(26)7-13/h4-12,21,31H,1-3H3,(H2,27,28)(H,29,32)(H,30,33)/t21-/m1/s1
Standard InChI Key: AZVXWPCFOZFXMJ-OAQYLSRUSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
39.2692 -3.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2680 -4.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9761 -4.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6857 -4.5707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6829 -3.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.9743 -3.3428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5634 -3.3434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5646 -2.5251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8576 -2.1167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.1490 -2.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1518 -3.3469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8594 -3.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4407 -2.1180 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.4438 -3.7593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7345 -3.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.4468 -4.5765 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.3941 -4.9782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.1011 -4.5685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8095 -4.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0999 -3.7513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5166 -4.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2236 -4.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9302 -4.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9293 -3.7480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2160 -3.3407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5124 -3.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6383 -4.9739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.2119 -2.5235 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
42.8108 -5.7931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1561 -4.9824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1592 -5.7996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8623 -4.5711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5600 -4.9792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.5593 -5.7964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
1 7 1 0
10 13 1 0
14 15 2 0
14 16 1 0
11 14 1 0
4 17 1 0
17 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
23 27 1 0
25 28 1 0
19 29 1 1
16 30 1 0
30 31 1 0
30 32 1 0
2 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.48Molecular Weight (Monoisotopic): 470.1766AlogP: 3.43#Rotatable Bonds: 7Polar Surface Area: 126.57Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.95CX Basic pKa: 4.89CX LogP: 3.15CX LogD: 3.15Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.42Np Likeness Score: -0.97
References 1. Calvo V, Surguladze D, Li AH, Surman MD, Malibhatla S, Bandaru M, Jonnalagadda SK, Adarasandi R, Velmala M, Singireddi DRP, Velpuri M, Nareddy BR, Sastry V, Mandati C, Guguloth R, Siddiqui S, Patil BS, Chad E, Wolfley J, Gasparek J, Feldman K, Betzenhauser M, Wiens B, Koszelak-Rosenblum M, Zhu G, Du H, Rigby AC, Mulvihill MJ.. (2021) Discovery of 2-amino-3-amido-5-aryl-pyridines as highly potent, orally bioavailable, and efficacious PERK kinase inhibitors., 43 [PMID:33895276 ] [10.1016/j.bmcl.2021.128058 ]