The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-benzyloxy-2-((8-ethoxy-4-methyl)ethylnona-3E,7Z-dienoate)-2-methyl-dihydrobenzopyran ID: ALA4870584
PubChem CID: 146730153
Max Phase: Preclinical
Molecular Formula: C31H40O5
Molecular Weight: 492.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C(=C/CC/C(C)=C/CCC1(C)CCc2cc(OCc3ccccc3)ccc2O1)OCC
Standard InChI: InChI=1S/C31H40O5/c1-5-33-29(30(32)34-6-2)16-10-12-24(3)13-11-20-31(4)21-19-26-22-27(17-18-28(26)36-31)35-23-25-14-8-7-9-15-25/h7-9,13-18,22H,5-6,10-12,19-21,23H2,1-4H3/b24-13+,29-16-
Standard InChI Key: RHGWCSYMDMQCNT-WWCVEJJESA-N
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
15.4179 -13.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4168 -13.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1248 -14.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1230 -12.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7087 -14.2572 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8316 -13.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8305 -13.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5406 -14.2626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2564 -13.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2576 -13.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5429 -12.6122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0430 -13.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2506 -12.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6191 -12.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4091 -12.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9852 -12.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7752 -12.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7081 -15.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0001 -15.4824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2944 -15.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5869 -15.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5858 -16.2959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2981 -16.7049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0028 -16.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3513 -11.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1413 -12.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7174 -11.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7714 -11.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5074 -11.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0835 -11.1748 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8735 -11.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4496 -10.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7212 -12.5430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.5035 -10.7565 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0797 -10.1769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8658 -9.3882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 7 2 0
6 4 2 0
4 1 1 0
2 5 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
12 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
5 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
26 27 2 0
16 28 1 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
29 33 2 0
27 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.66Molecular Weight (Monoisotopic): 492.2876AlogP: 7.34#Rotatable Bonds: 13Polar Surface Area: 53.99Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.44CX LogD: 7.44Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: 1.01
References 1. García A, Vila L, Marín P, Bernabeu Á, Villarroel-Vicente C, Hennuyer N, Staels B, Franck X, Figadère B, Cabedo N, Cortes D.. (2021) Synthesis of 2-Prenylated Alkoxylated Benzopyrans by Horner-Wadsworth-Emmons Olefination with PPARα/γ Agonist Activity., 12 (11.0): [PMID:34795868 ] [10.1021/acsmedchemlett.1c00400 ]