The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Gelselegine ID: ALA4870600
PubChem CID: 14781525
Max Phase: Preclinical
Molecular Formula: C20H26N2O4
Molecular Weight: 358.44
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(CO)N[C@H]2C[C@@]3(C(=O)N(OC)c4ccccc43)[C@H]3C[C@@H]1[C@@H]2CO3
Standard InChI: InChI=1S/C20H26N2O4/c1-3-19(11-23)14-8-17-20(9-15(21-19)12(14)10-26-17)13-6-4-5-7-16(13)22(25-2)18(20)24/h4-7,12,14-15,17,21,23H,3,8-11H2,1-2H3/t12-,14+,15-,17+,19-,20-/m0/s1
Standard InChI Key: ZREVWZNVVDYUMA-SJBBDNDTSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
49.4768 -11.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.7351 -10.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.7340 -11.6645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.5374 -9.9540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.3280 -9.1568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.2799 -8.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.4555 -8.6171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.1328 -10.9193 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.8687 -10.5471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7316 -9.7388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5535 -10.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9288 -9.6068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4886 -8.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6640 -8.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2911 -9.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7382 -10.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0016 -11.7363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.2319 -12.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.6037 -10.9211 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.9587 -10.6912 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
48.4508 -9.5052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.7415 -9.9220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.9186 -10.7257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
49.0686 -10.0511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.3551 -10.3615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.7370 -9.0612 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
49.1884 -9.0703 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
49.8881 -9.7945 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
47.9896 -12.0894 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
49.4758 -12.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 6
21 6 1 0
6 7 1 0
10 5 1 6
10 12 1 0
11 8 1 0
8 9 1 0
9 10 1 0
4 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 17 1 0
17 18 1 0
9 19 2 0
4 20 1 1
21 22 1 0
22 23 1 0
23 2 1 0
2 24 1 0
24 21 1 0
24 25 1 0
25 4 1 0
22 26 1 6
21 27 1 6
24 28 1 1
3 29 1 0
1 30 1 0
22 5 1 0
4 7 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 358.44Molecular Weight (Monoisotopic): 358.1893AlogP: 1.37#Rotatable Bonds: 3Polar Surface Area: 71.03Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.83CX LogP: 0.96CX LogD: -2.06Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: 2.07
References 1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G.. (2021) Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems., 84 (4.0): [PMID:33826318 ] [10.1021/acs.jnatprod.1c00062 ]