Gelselegine

ID: ALA4870600

PubChem CID: 14781525

Max Phase: Preclinical

Molecular Formula: C20H26N2O4

Molecular Weight: 358.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@@]1(CO)N[C@H]2C[C@@]3(C(=O)N(OC)c4ccccc43)[C@H]3C[C@@H]1[C@@H]2CO3

Standard InChI:  InChI=1S/C20H26N2O4/c1-3-19(11-23)14-8-17-20(9-15(21-19)12(14)10-26-17)13-6-4-5-7-16(13)22(25-2)18(20)24/h4-7,12,14-15,17,21,23H,3,8-11H2,1-2H3/t12-,14+,15-,17+,19-,20-/m0/s1

Standard InChI Key:  ZREVWZNVVDYUMA-SJBBDNDTSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   49.4768  -11.2360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.7351  -10.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.7340  -11.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.5374   -9.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.3280   -9.1568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.2799   -8.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.4555   -8.6171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.1328  -10.9193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.8687  -10.5471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7316   -9.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5535  -10.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.9288   -9.6068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.4886   -8.9162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.6640   -8.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2911   -9.6864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.7382  -10.3738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0016  -11.7363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.2319  -12.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.6037  -10.9211    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   46.9587  -10.6912    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   48.4508   -9.5052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.7415   -9.9220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.9186  -10.7257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   49.0686  -10.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.3551  -10.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.7370   -9.0612    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   49.1884   -9.0703    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   49.8881   -9.7945    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   47.9896  -12.0894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   49.4758  -12.0922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  6
 21  6  1  0
  6  7  1  0
 10  5  1  6
 10 12  1  0
 11  8  1  0
  8  9  1  0
  9 10  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 17  1  0
 17 18  1  0
  9 19  2  0
  4 20  1  1
 21 22  1  0
 22 23  1  0
 23  2  1  0
  2 24  1  0
 24 21  1  0
 24 25  1  0
 25  4  1  0
 22 26  1  6
 21 27  1  6
 24 28  1  1
  3 29  1  0
  1 30  1  0
 22  5  1  0
  4  7  1  0
M  END

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 358.44Molecular Weight (Monoisotopic): 358.1893AlogP: 1.37#Rotatable Bonds: 3
Polar Surface Area: 71.03Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.83CX LogP: 0.96CX LogD: -2.06
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.85Np Likeness Score: 2.07

References

1. Jin P, Zhan G, Zheng G, Liu J, Peng X, Huang L, Gao B, Yuan X, Yao G..  (2021)  Gelstriamine A, a Triamino Monoterpene Indole Alkaloid with a Caged 6/5/7/6/6/5 Scaffold and Analgesic Alkaloids from Gelsemium elegans Stems.,  84  (4.0): [PMID:33826318] [10.1021/acs.jnatprod.1c00062]

Source