The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2,4-dimethoxy-N-(4-(phenyldiazenyl)phenyl)benzenesulfonamide ID: ALA4870604
Cas Number: 902697-75-0
PubChem CID: 22774849
Max Phase: Preclinical
Molecular Formula: C20H19N3O4S
Molecular Weight: 397.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)Nc2ccc(/N=N/c3ccccc3)cc2)c(OC)c1
Standard InChI: InChI=1S/C20H19N3O4S/c1-26-18-12-13-20(19(14-18)27-2)28(24,25)23-17-10-8-16(9-11-17)22-21-15-6-4-3-5-7-15/h3-14,23H,1-2H3/b22-21+
Standard InChI Key: NGJUJTABKNSJKU-QURGRASLSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
33.3769 -9.1542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7896 -9.8641 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.1980 -9.1517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.2080 -9.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2068 -9.8664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9149 -10.2753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6245 -9.8659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6217 -9.0432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9131 -8.6380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3279 -8.6320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.0371 -9.0379 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7433 -8.6267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4509 -9.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1566 -8.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1540 -7.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4398 -7.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7370 -7.8145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4988 -10.2744 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.0834 -10.2733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3766 -9.8641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6708 -10.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6717 -11.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3842 -11.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0870 -11.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3766 -9.0469 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6689 -8.6383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9652 -11.5004 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.2563 -11.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
8 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
5 18 1 0
18 2 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
20 25 1 0
25 26 1 0
22 27 1 0
27 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 397.46Molecular Weight (Monoisotopic): 397.1096AlogP: 4.92#Rotatable Bonds: 7Polar Surface Area: 89.35Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.20CX Basic pKa: 0.80CX LogP: 4.55CX LogD: 4.21Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.57Np Likeness Score: -1.28
References 1. Giampietro L, Gallorini M, Gambacorta N, Ammazzalorso A, De Filippis B, Della Valle A, Fantacuzzi M, Maccallini C, Mollica A, Cataldi A, Nicolotti O, Amoroso R.. (2021) Synthesis, structure-activity relationships and molecular docking studies of phenyldiazenyl sulfonamides as aromatase inhibitors., 224 [PMID:34365129 ] [10.1016/j.ejmech.2021.113737 ]