The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-((4-isobutyrylpiperazin-1-yl)methyl)-4H-chromen-4-one ID: ALA4870649
PubChem CID: 164624686
Max Phase: Preclinical
Molecular Formula: C24H26N2O6
Molecular Weight: 438.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C(=O)N1CCN(Cc2c(O)cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)CC1
Standard InChI: InChI=1S/C24H26N2O6/c1-14(2)24(31)26-9-7-25(8-10-26)13-17-18(28)11-19(29)22-20(30)12-21(32-23(17)22)15-3-5-16(27)6-4-15/h3-6,11-12,14,27-29H,7-10,13H2,1-2H3
Standard InChI Key: KPZHEWFZIDTJAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
19.4354 -13.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4343 -14.1977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1490 -14.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1472 -12.9576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8625 -13.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8614 -14.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5782 -14.6150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3009 -14.2018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3021 -13.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5806 -12.9489 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7208 -12.9580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1487 -15.4355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.5759 -15.4400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1448 -12.1326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4291 -11.7222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4292 -10.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7177 -10.4835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0021 -10.8946 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.0025 -11.7205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7186 -12.1353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2879 -10.4815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2885 -9.6566 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5731 -10.8934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0159 -12.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7296 -13.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4445 -12.9666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4470 -12.1407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7285 -11.7266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0165 -12.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1619 -11.7290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.8591 -10.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5725 -11.7184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
1 11 1 0
3 12 1 0
7 13 2 0
4 14 1 0
14 15 1 0
15 16 1 0
15 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
18 21 1 0
21 22 2 0
21 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
9 24 1 0
27 30 1 0
23 31 1 0
23 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.48Molecular Weight (Monoisotopic): 438.1791AlogP: 2.88#Rotatable Bonds: 4Polar Surface Area: 114.45Molecular Species: ACIDHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.21CX Basic pKa: 6.18CX LogP: 2.40CX LogD: 1.41Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.57Np Likeness Score: 0.18
References 1. Long H, Hu X, Wang B, Wang Q, Wang R, Liu S, Xiong F, Jiang Z, Zhang XQ, Ye WC, Wang H.. (2021) Discovery of Novel Apigenin-Piperazine Hybrids as Potent and Selective Poly (ADP-Ribose) Polymerase-1 (PARP-1) Inhibitors for the Treatment of Cancer., 64 (16.0): [PMID:34404206 ] [10.1021/acs.jmedchem.1c00735 ]