The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-(N-(1-(1H-Indol-3-yl)-2-((3-methoxyphenethyl)amino)-2-oxoethyl)-2-chloroacetamido)benzoate ID: ALA4870663
PubChem CID: 164625242
Max Phase: Preclinical
Molecular Formula: C30H30ClN3O5
Molecular Weight: 548.04
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(N(C(=O)CCl)C(C(=O)NCCc2cccc(OC)c2)c2c[nH]c3ccccc23)cc1
Standard InChI: InChI=1S/C30H30ClN3O5/c1-3-39-30(37)21-11-13-22(14-12-21)34(27(35)18-31)28(25-19-33-26-10-5-4-9-24(25)26)29(36)32-16-15-20-7-6-8-23(17-20)38-2/h4-14,17,19,28,33H,3,15-16,18H2,1-2H3,(H,32,36)
Standard InChI Key: AATRJDKNPFHVHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
32.8040 -24.5977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8027 -25.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5175 -25.8378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.5157 -24.1850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2310 -24.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.2359 -25.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0277 -25.6772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5122 -25.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0198 -24.3327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.2850 -26.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7345 -27.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.9910 -27.8539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7983 -28.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3488 -27.4094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0920 -26.6226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.6410 -26.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0559 -28.8087 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.4411 -28.4688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9270 -26.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.1562 -27.5789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.4477 -26.1800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9965 -25.5650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7379 -24.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9255 -24.6149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3803 -25.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6335 -28.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2862 -24.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0941 -24.3308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.6423 -23.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4502 -23.8810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0264 -23.3813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.0837 -28.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2765 -28.7443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7269 -29.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9844 -30.1431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7966 -30.3102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3426 -29.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0569 -31.0929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.5092 -31.7098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
13 14 1 0
14 15 1 0
7 10 1 0
15 16 1 0
13 17 1 0
12 18 1 0
11 19 2 0
14 20 2 0
16 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 16 1 0
18 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
27 31 2 0
26 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
36 38 1 0
38 39 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.04Molecular Weight (Monoisotopic): 547.1874AlogP: 5.03#Rotatable Bonds: 11Polar Surface Area: 100.73Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.76CX LogD: 4.76Aromatic Rings: 4Heavy Atoms: 39QED Weighted: 0.20Np Likeness Score: -0.90
References 1. Xu C, Xiao Z, Wang J, Lai H, Zhang T, Guan Z, Xia M, Chen M, Ren L, He Y, Gao Y, Zhao C.. (2021) Discovery of a Potent Glutathione Peroxidase 4 Inhibitor as a Selective Ferroptosis Inducer., 64 (18.0): [PMID:34506134 ] [10.1021/acs.jmedchem.1c00569 ]