The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-(4-(4-(2-(2,4-difluorophenyl)-2-hydroxy-3-(1H-1,2,4-triazol-1-yl)propyl)piperazin-1-yl)butoxy)phenyl)-N-hydroxyacetamide ID: ALA4870687
PubChem CID: 164618970
Max Phase: Preclinical
Molecular Formula: C27H34F2N6O4
Molecular Weight: 544.60
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccc(OCCCCN2CCN(CC(O)(Cn3cncn3)c3ccc(F)cc3F)CC2)cc1)NO
Standard InChI: InChI=1S/C27H34F2N6O4/c28-22-5-8-24(25(29)16-22)27(37,18-35-20-30-19-31-35)17-34-12-10-33(11-13-34)9-1-2-14-39-23-6-3-21(4-7-23)15-26(36)32-38/h3-8,16,19-20,37-38H,1-2,9-15,17-18H2,(H,32,36)
Standard InChI Key: OBBUFAKTCIAAHE-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
18.7051 -15.8883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2968 -15.1758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8839 -15.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7260 -15.1716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7260 -15.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4381 -16.4050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1502 -15.9966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.1502 -15.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4381 -14.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8641 -16.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0103 -14.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5813 -14.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5790 -13.9404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2473 -13.4546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9902 -12.6707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1650 -12.6730 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.9124 -13.4584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0631 -15.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6502 -16.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0587 -17.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8842 -17.3033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2933 -16.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6541 -15.1642 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.6448 -18.0170 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5792 -15.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2930 -16.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0082 -16.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7220 -16.4144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.4372 -16.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1476 -16.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8622 -16.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8638 -15.1838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1449 -14.7705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4332 -15.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5784 -14.7714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2928 -15.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0074 -14.7716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2927 -16.0090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.7218 -15.1842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
4 9 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
7 10 1 0
4 11 1 0
11 2 1 0
2 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 13 1 0
3 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 3 1 0
18 23 1 0
20 24 1 0
10 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
35 36 1 0
36 37 1 0
36 38 2 0
37 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.60Molecular Weight (Monoisotopic): 544.2610AlogP: 1.97#Rotatable Bonds: 13Polar Surface Area: 115.98Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.90CX Basic pKa: 7.84CX LogP: 1.63CX LogD: 1.31Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.17Np Likeness Score: -1.05
References 1. Zhu T, Chen X, Li C, Tu J, Liu N, Xu D, Sheng C.. (2021) Lanosterol 14α-demethylase (CYP51)/histone deacetylase (HDAC) dual inhibitors for treatment of Candida tropicalis and Cryptococcus neoformans infections., 221 [PMID:33992927 ] [10.1016/j.ejmech.2021.113524 ]