The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,2'S)-2,2'-thiocarbonylbis(azanediyl)dipentanedioic acid ID: ALA4870708
PubChem CID: 88900290
Max Phase: Preclinical
Molecular Formula: C11H16N2O8S
Molecular Weight: 336.32
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CC[C@H](NC(=S)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O
Standard InChI: InChI=1S/C11H16N2O8S/c14-7(15)3-1-5(9(18)19)12-11(22)13-6(10(20)21)2-4-8(16)17/h5-6H,1-4H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)(H2,12,13,22)/t5-,6-/m0/s1
Standard InChI Key: LLFVSSPVFBEUOJ-WDSKDSINSA-N
Molfile:
RDKit 2D
22 21 0 0 0 0 0 0 0 0999 V2000
18.0731 -4.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7808 -3.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3654 -3.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.0731 -4.8908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4886 -4.0736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1963 -3.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9040 -4.0736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.1963 -2.8478 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.6117 -3.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3194 -4.0736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0271 -3.6650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.3194 -4.8908 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6117 -2.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7808 -2.8478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3194 -2.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3194 -1.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0271 -1.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.6117 -1.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.4885 -2.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4885 -1.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1963 -1.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7808 -1.2134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
1 4 2 0
2 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
10 12 2 0
9 13 1 1
2 14 1 6
13 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
14 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 336.32Molecular Weight (Monoisotopic): 336.0627AlogP: -0.91#Rotatable Bonds: 10Polar Surface Area: 173.26Molecular Species: ACIDHBA: 5HBD: 6#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.09CX Basic pKa: ┄CX LogP: -0.64CX LogD: -13.28Aromatic Rings: ┄Heavy Atoms: 22QED Weighted: 0.27Np Likeness Score: 0.06
References 1. Young JD, Ma MT, Eykyn TR, Atkinson RA, Abbate V, Cilibrizzi A, Hider RC, Blower PJ.. (2021) Dipeptide inhibitors of the prostate specific membrane antigen (PSMA): A comparison of urea and thiourea derivatives., 42 [PMID:33865971 ] [10.1016/j.bmcl.2021.128044 ]