(3S,19aS)-N-((S)-4-Methyl-1-((R)-2-methyloxiran-2-yl)-1-oxopentan-2-yl)-1,12,15-trioxooctadecahydropyrrolo[2,1-f][1]oxa[4,7,10]-triazacycloheptadecine-3-carboxamide

ID: ALA4870740

PubChem CID: 164620683

Max Phase: Preclinical

Molecular Formula: C26H42N4O7

Molecular Weight: 522.64

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@@H]1COCCCCCCC(=O)NCC(=O)N2CCC[C@H]2C(=O)N1)C(=O)[C@@]1(C)CO1

Standard InChI:  InChI=1S/C26H42N4O7/c1-17(2)13-18(23(33)26(3)16-37-26)28-24(34)19-15-36-12-7-5-4-6-10-21(31)27-14-22(32)30-11-8-9-20(30)25(35)29-19/h17-20H,4-16H2,1-3H3,(H,27,31)(H,28,34)(H,29,35)/t18-,19-,20-,26+/m0/s1

Standard InChI Key:  FQXFPJCBQXLSMF-XNCCSTQDSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
   25.8488  -14.6199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2681  -15.3341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6811  -14.6161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2309  -15.7081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8384  -16.2702    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.5583  -15.8642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3993  -15.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5780  -14.9559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3126  -16.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3876  -17.0360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9897  -15.7352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.7381  -16.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4175  -15.6036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1672  -15.9480    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3465  -14.7782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.8172  -16.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8402  -15.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5905  -15.8173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6655  -16.6426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.7652  -14.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0201  -15.6891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9660  -15.1503    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   25.4270  -14.1824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2364  -14.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4224  -13.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7442  -17.0747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0004  -17.3954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3939  -17.5585    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9941  -18.2022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.6925  -18.6125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6863  -19.4225    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.5543  -17.2395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3970  -18.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0953  -18.6234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9554  -18.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6538  -18.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2683  -18.5824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7328  -18.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  1  3  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 12 16  1  6
 14 17  1  0
 17 18  1  0
 18 19  2  0
 17 20  1  1
 18  2  1  0
  2 21  1  6
  6 22  1  6
 20 23  1  0
 23 24  1  0
 23 25  1  0
  5 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  2  0
 16 32  1  0
 30 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 32 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4870740

    ---

Associated Targets(Human)

PSMB9 Tchem Proteasome subunit beta type-9 (308 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB8 Tclin Proteasome subunit beta type-8 (743 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 522.64Molecular Weight (Monoisotopic): 522.3053AlogP: 0.45#Rotatable Bonds: 6
Polar Surface Area: 146.44Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.90CX Basic pKa: CX LogP: 0.37CX LogD: 0.37
Aromatic Rings: Heavy Atoms: 37QED Weighted: 0.43Np Likeness Score: 0.45

References

1. Lee MJ, Bhattarai D, Jang H, Baek A, Yeo IJ, Lee S, Miller Z, Lee S, Hong JT, Kim DE, Lee W, Kim KB..  (2021)  Macrocyclic Immunoproteasome Inhibitors as a Potential Therapy for Alzheimer's Disease.,  64  (15.0): [PMID:34309393] [10.1021/acs.jmedchem.1c00291]
2. de Bruin, Gerjan G and 11 more authors.  2014-07-24  Structure-based design of β1i or β5i specific inhibitors of human immunoproteasomes.  [PMID:25006746]
3. Johnson, Henry W B HWB and 12 more authors.  2017-04-13  Discovery of Highly Selective Inhibitors of the Immunoproteasome Low Molecular Mass Polypeptide 2 (LMP2) Subunit.  [PMID:28435528]
4. Xie, Stanley C and 20 more authors.  2018-11-21  Target Validation and Identification of Novel Boronate Inhibitors of the Plasmodium falciparum Proteasome.  [PMID:30373366]
5. Johnson, Henry W B HWB and 8 more authors.  2018-12-27  Required Immunoproteasome Subunit Inhibition Profile for Anti-Inflammatory Efficacy and Clinical Candidate KZR-616 ((2 S,3 R)- N-(( S)-3-(Cyclopent-1-en-1-yl)-1-(( R)-2-methyloxiran-2-yl)-1-oxopropan-2-yl)-3-hydroxy-3-(4-methoxyphenyl)-2-(( S)-2-(2-morpholinoacetamido)propanamido)propenamide).  [PMID:30380863]
6. Bhattarai, Deepak and 9 more authors.  2020-04-09  LMP2 Inhibitors as a Potential Treatment for Alzheimer's Disease.  [PMID:32189500]

Source