The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
cis-4-((5-Cyano-2-(((4-(trifluoromethyl)pyridin-3-yl)methyl)amino)pyridin-4-yl)amino)cyclohexane-1-carboxamide ID: ALA4870774
PubChem CID: 164621995
Max Phase: Preclinical
Molecular Formula: C20H21F3N6O
Molecular Weight: 418.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cnc(NCc2cnccc2C(F)(F)F)cc1N[C@H]1CC[C@@H](C(N)=O)CC1
Standard InChI: InChI=1S/C20H21F3N6O/c21-20(22,23)16-5-6-26-9-14(16)11-28-18-7-17(13(8-24)10-27-18)29-15-3-1-12(2-4-15)19(25)30/h5-7,9-10,12,15H,1-4,11H2,(H2,25,30)(H2,27,28,29)/t12-,15+
Standard InChI Key: YCFZRTPAYLSXMM-JNSHFYNHSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
13.1328 -9.1996 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.9500 -9.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5414 -8.4919 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
18.2237 -7.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5079 -8.0389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8100 -7.6196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0942 -8.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0805 -8.8301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7784 -9.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.4942 -8.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9395 -7.2476 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3647 -9.2278 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3509 -10.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6214 -11.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6351 -10.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9372 -10.0191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2214 -10.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2076 -11.2338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9056 -11.6531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.6654 -8.8055 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
16.8257 -6.8025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5411 -6.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2385 -6.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9517 -6.4394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9715 -5.6221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2720 -5.1979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5526 -5.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6884 -5.2298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3866 -5.6546 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7072 -4.4129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 11 3 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
16 2 1 0
13 15 1 0
12 13 1 0
8 12 1 0
2 20 1 0
6 21 1 0
22 21 1 1
22 23 1 0
22 27 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
25 28 1 1
28 29 1 0
28 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.42Molecular Weight (Monoisotopic): 418.1729AlogP: 3.44#Rotatable Bonds: 6Polar Surface Area: 116.72Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.55CX LogP: 1.75CX LogD: 1.70Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.58
References 1. Papa P, Whitefield B, Mortensen DS, Cashion D, Huang D, Torres E, Parnes J, Sapienza J, Hansen J, Correa M, Delgado M, Harris R, Hegde S, Norris S, Bahmanyar S, Plantevin-Krenitsky V, Liu Z, Leftheris K, Kulkarni A, Bennett B, Hur EM, Ringheim G, Khambatta G, Chan H, Muir J, Blease K, Burnett K, LeBrun L, Morrison L, Celeridad M, Khattri R, Cathers BE.. (2021) Discovery of the Selective Protein Kinase C-θ Kinase Inhibitor, CC-90005., 64 (16.0): [PMID:34355886 ] [10.1021/acs.jmedchem.1c00388 ]