The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 2-(4-((1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl)-2-(trifluoromethyl)phenoxy)acetate ID: ALA4870888
PubChem CID: 164621137
Max Phase: Preclinical
Molecular Formula: C24H21F3O7
Molecular Weight: 478.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)COc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)cc1C(F)(F)F
Standard InChI: InChI=1S/C24H21F3O7/c1-32-22-12-16(5-9-20(22)30)4-8-18(29)13-17(28)7-3-15-6-10-21(34-14-23(31)33-2)19(11-15)24(25,26)27/h3-12,30H,13-14H2,1-2H3/b7-3+,8-4+
Standard InChI Key: PGJNUZLHOQESIJ-FCXRPNKRSA-N
Molfile:
RDKit 2D
34 35 0 0 0 0 0 0 0 0999 V2000
20.6668 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3813 -2.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0958 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 -2.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5247 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3813 -1.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8102 -1.3833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9523 -2.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2378 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2392 -2.2083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9536 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9515 -3.4469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6652 -3.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3807 -3.4468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3780 -2.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6638 -2.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5239 -2.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8100 -2.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8095 -3.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5290 -3.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2400 -3.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0956 -3.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0957 -2.2042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0961 -1.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0910 -2.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8070 -2.6124 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.0881 -1.3775 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.8002 -1.7834 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.0956 -3.8583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.8096 -3.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5246 -3.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2385 -3.4430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5257 -4.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.9536 -3.8545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
2 6 2 0
4 7 2 0
1 8 2 0
8 9 1 0
5 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 9 1 0
19 22 1 0
18 23 1 0
23 24 1 0
15 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
14 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.42Molecular Weight (Monoisotopic): 478.1239AlogP: 4.23#Rotatable Bonds: 10Polar Surface Area: 99.13Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: ┄CX LogP: 4.93CX LogD: 4.92Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.31Np Likeness Score: 0.09
References 1. Yudi Utomo R, Asawa Y, Okada S, Ban HS, Yoshimori A, Bajorath J, Nakamura H.. (2021) Development of curcumin-based amyloid β aggregation inhibitors for Alzheimer's disease using the SAR matrix approach., 46 [PMID:34391121 ] [10.1016/j.bmc.2021.116357 ]