The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[[4-fluoro-3-(7-methyl-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbonyl)phenyl]methyl]-2H-phthalazin-1-one ID: ALA4870960
PubChem CID: 164622937
Max Phase: Preclinical
Molecular Formula: C27H22FN5O2
Molecular Weight: 467.50
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc3n(c2c1)CCN(C(=O)c1cc(Cc2n[nH]c(=O)c4ccccc24)ccc1F)C3
Standard InChI: InChI=1S/C27H22FN5O2/c1-16-6-9-22-24(12-16)33-11-10-32(15-25(33)29-22)27(35)20-13-17(7-8-21(20)28)14-23-18-4-2-3-5-19(18)26(34)31-30-23/h2-9,12-13H,10-11,14-15H2,1H3,(H,31,34)
Standard InChI Key: AIPDWZSAAUJOIQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
2.2025 -25.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2014 -26.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9094 -26.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9076 -24.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6163 -25.2426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6151 -26.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3213 -26.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0332 -26.0653 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0343 -25.2446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3236 -24.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3171 -24.0122 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3190 -27.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0256 -27.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0219 -28.5161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7277 -28.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4375 -28.5199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4372 -27.6985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7308 -27.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1446 -28.9295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.1446 -27.2894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8526 -27.6974 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1440 -26.4722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8484 -28.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5523 -28.9195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5551 -27.2832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2635 -27.6957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2653 -28.5131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0403 -27.4414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5223 -28.1016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0450 -28.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3778 -29.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1877 -29.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6637 -28.9205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3283 -28.1820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5238 -30.3300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
16 19 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
21 25 1 0
23 24 1 0
24 27 1 0
26 25 1 0
26 27 1 0
27 30 1 0
29 28 1 0
28 26 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.50Molecular Weight (Monoisotopic): 467.1758AlogP: 3.97#Rotatable Bonds: 3Polar Surface Area: 83.88Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.96CX Basic pKa: 5.07CX LogP: 3.76CX LogD: 3.76Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.44Np Likeness Score: -1.76
References 1. Shen H, Ge Y, Wang J, Li H, Xu Y, Zhu Q.. (2021) Design, synthesis and biological evaluation of novel molecules as potent PARP-1 inhibitors., 47 [PMID:34091044 ] [10.1016/j.bmcl.2021.128169 ]