(S)-phenyl 3-((S)-2-(isonicotinamido)-3-(p-tolyl)propanamido)-5-phenylpent-1-ene-1-sulfonate

ID: ALA4871105

PubChem CID: 164618981

Max Phase: Preclinical

Molecular Formula: C33H33N3O5S

Molecular Weight: 583.71

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(C[C@H](NC(=O)c2ccncc2)C(=O)N[C@H](/C=C/S(=O)(=O)Oc2ccccc2)CCc2ccccc2)cc1

Standard InChI:  InChI=1S/C33H33N3O5S/c1-25-12-14-27(15-13-25)24-31(36-32(37)28-18-21-34-22-19-28)33(38)35-29(17-16-26-8-4-2-5-9-26)20-23-42(39,40)41-30-10-6-3-7-11-30/h2-15,18-23,29,31H,16-17,24H2,1H3,(H,35,38)(H,36,37)/b23-20+/t29-,31-/m0/s1

Standard InChI Key:  IGKPCGHCYQCLEU-KOUGTPQRSA-N

Molfile:  

 
     RDKit          2D

 42 45  0  0  0  0  0  0  0  0999 V2000
   15.9930  -11.5273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5844  -10.8175    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1754  -11.5248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9012  -11.6429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9012  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913  -10.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1913   -9.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4773   -9.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674   -9.5876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7674  -10.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4773  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6070  -10.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3210  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3210  -11.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0350  -12.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7449  -11.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548  -12.0556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548  -12.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688  -13.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7449  -13.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0350  -12.8770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0350  -10.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7449  -10.8216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548  -10.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548   -9.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688   -9.1790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688   -8.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8787   -7.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8787   -7.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688   -6.7150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548   -7.1236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4548   -7.9449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1688  -10.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8787  -10.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0350   -9.5876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2982  -10.4072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0105  -10.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0065  -11.6399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7180  -12.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4304  -11.6380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4267  -10.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7147  -10.4044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
  6 11  1  0
  5 12  1  0
 12 13  1  0
 13 14  1  6
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 15 21  1  0
 13 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  1
 25 26  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 27 32  1  0
 24 33  1  0
 33 34  2  0
 22 35  2  0
 34  2  1  0
  2 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871105

    ---

Associated Targets(non-human)

rhodesain Rhodesain (1463 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 583.71Molecular Weight (Monoisotopic): 583.2141AlogP: 4.77#Rotatable Bonds: 13
Polar Surface Area: 114.46Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.70CX Basic pKa: 3.39CX LogP: 5.41CX LogD: 5.41
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.22Np Likeness Score: -0.39

References

1. Jung S, Fuchs N, Johe P, Wagner A, Diehl E, Yuliani T, Zimmer C, Barthels F, Zimmermann RA, Klein P, Waigel W, Meyr J, Opatz T, Tenzer S, Distler U, Räder HJ, Kersten C, Engels B, Hellmich UA, Klein J, Schirmeister T..  (2021)  Fluorovinylsulfones and -Sulfonates as Potent Covalent Reversible Inhibitors of the Trypanosomal Cysteine Protease Rhodesain: Structure-Activity Relationship, Inhibition Mechanism, Metabolism, and In Vivo Studies.,  64  (16.0): [PMID:34378914] [10.1021/acs.jmedchem.1c01002]

Source