3-((2-(4-(furan-2-carboxamido)-2-methyl-1H-indol-1-yl)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-4-ylamino)methyl)phenylboronic acid

ID: ALA4871208

PubChem CID: 164619418

Max Phase: Preclinical

Molecular Formula: C28H26BN5O5

Molecular Weight: 523.36

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc2c(NC(=O)c3ccco3)cccc2n1-c1nc2c(c(NCc3cccc(B(O)O)c3)n1)COCC2

Standard InChI:  InChI=1S/C28H26BN5O5/c1-17-13-20-22(31-27(35)25-9-4-11-39-25)7-3-8-24(20)34(17)28-32-23-10-12-38-16-21(23)26(33-28)30-15-18-5-2-6-19(14-18)29(36)37/h2-9,11,13-14,36-37H,10,12,15-16H2,1H3,(H,31,35)(H,30,32,33)

Standard InChI Key:  CSAOOHPSIAXBEN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   24.7548  -14.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4645  -14.4843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4617  -13.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7531  -13.2564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1678  -13.2504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7546  -15.7109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.4623  -16.1197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4621  -16.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7538  -17.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7533  -18.1574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4614  -18.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1716  -18.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1686  -17.3391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0485  -12.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2498  -12.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8806  -18.5605    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   26.8833  -19.3777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5870  -18.1496    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4598  -12.9681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9156  -13.5769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1712  -14.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.9706  -14.5163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5138  -13.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2553  -13.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6402  -11.8906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9608  -12.7160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.6719  -13.1186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6788  -13.9357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.3761  -12.7040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0485  -14.4828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0435  -13.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3395  -13.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6360  -13.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6410  -14.4914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3495  -14.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1217  -13.0279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.6633  -12.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2487  -11.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4509  -11.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 30  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 31  1  0
  3  5  1  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  5 20  1  0
 19 14  1  0
 14 15  2  0
 15  5  1  0
 12 16  1  0
 16 17  1  0
 16 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 15 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 30 31  2  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 29 36  1  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4871208

    ---

Associated Targets(Human)

VCP Tchem Transitional endoplasmic reticulum ATPase (895 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 523.36Molecular Weight (Monoisotopic): 523.2027AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Zhang Y, Xie X, Wang X, Wen T, Zhao C, Liu H, Zhao B, Zhu Y..  (2021)  Discovery of novel pyrimidine molecules containing boronic acid as VCP/p97 Inhibitors.,  38  [PMID:33831696] [10.1016/j.bmc.2021.116114]

Source