N-(4-([1,2,4]Triazolo[4,3-a]quinoxalin-4-ylamino)phenyl)-2-chloro-5-methoxybenzenesulfonamide

ID: ALA4871240

PubChem CID: 164619839

Max Phase: Preclinical

Molecular Formula: C22H17ClN6O3S

Molecular Weight: 480.94

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(Cl)c(S(=O)(=O)Nc2ccc(Nc3nc4ccccc4n4cnnc34)cc2)c1

Standard InChI:  InChI=1S/C22H17ClN6O3S/c1-32-16-10-11-17(23)20(12-16)33(30,31)28-15-8-6-14(7-9-15)25-21-22-27-24-13-29(22)19-5-3-2-4-18(19)26-21/h2-13,28H,1H3,(H,25,26)

Standard InChI Key:  RPUPQBKJIQABKF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   19.5713  -19.5589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.9935  -20.1409    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.7864  -20.3503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2928  -19.7236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3064  -18.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6074  -18.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8926  -18.8807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8790  -19.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5802  -20.1187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9969  -20.9653    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.7037  -21.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4110  -20.9589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1219  -21.3685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1214  -22.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4183  -22.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7074  -22.1920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8323  -22.5911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5464  -24.6350    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5428  -23.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8360  -23.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1287  -23.8201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1283  -24.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4251  -25.0490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4288  -25.8662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1356  -26.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8428  -25.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8392  -25.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8020  -24.2208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3189  -23.5597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3248  -24.8821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0216  -18.5100    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.1655  -20.0933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1523  -20.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  2  0
  2 10  1  0
  4  2  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 18 27  1  0
 22 27  2  0
 28 29  1  0
 28 30  2  0
 18 30  1  0
 19 29  2  0
 17 20  1  0
 14 17  1  0
 10 11  1  0
  5 31  1  0
 32 33  1  0
  8 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871240

    ---

Associated Targets(non-human)

Slc14a2 Urea transporter 2 (74 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 480.94Molecular Weight (Monoisotopic): 480.0771AlogP: 4.48#Rotatable Bonds: 6
Polar Surface Area: 110.51Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.32CX Basic pKa: 1.38CX LogP: 2.95CX LogD: 2.67
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -2.01

References

1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS..  (2018)  Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1.,  61  (7.0): [PMID:29589443] [10.1021/acs.jmedchem.8b00343]

Source