The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(1H-imidazole-1-yl)-3-phenoxypropan-2-yl (4-methoxyphenyl)carbamate ID: ALA4871321
PubChem CID: 164619861
Max Phase: Preclinical
Molecular Formula: C20H21N3O4
Molecular Weight: 367.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(NC(=O)OC(COc2ccccc2)Cn2ccnc2)cc1
Standard InChI: InChI=1S/C20H21N3O4/c1-25-17-9-7-16(8-10-17)22-20(24)27-19(13-23-12-11-21-15-23)14-26-18-5-3-2-4-6-18/h2-12,15,19H,13-14H2,1H3,(H,22,24)
Standard InChI Key: HJIDOVBEJPPEKU-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 29 0 0 0 0 0 0 0 0999 V2000
34.1019 -7.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1007 -8.0133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8088 -8.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5184 -8.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5156 -7.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8070 -6.7849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3893 -8.4195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.6835 -8.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9739 -8.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2681 -8.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9700 -9.2300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5585 -8.4062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.8145 -8.0695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2648 -8.6742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6701 -9.3839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4702 -9.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6758 -9.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6719 -10.4592 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3857 -9.2408 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0896 -9.6560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0806 -10.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7837 -10.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4961 -10.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5011 -9.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7974 -9.2520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1982 -10.9010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.1887 -11.7182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 1 0
10 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 12 1 0
11 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 367.41Molecular Weight (Monoisotopic): 367.1532AlogP: 3.59#Rotatable Bonds: 8Polar Surface Area: 74.61Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.28CX Basic pKa: 6.77CX LogP: 3.28CX LogD: 3.22Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.66Np Likeness Score: -1.08
References 1. Ammazzalorso A, Gallorini M, Fantacuzzi M, Gambacorta N, De Filippis B, Giampietro L, Maccallini C, Nicolotti O, Cataldi A, Amoroso R.. (2021) Design, synthesis and biological evaluation of imidazole and triazole-based carbamates as novel aromatase inhibitors., 211 [PMID:33360796 ] [10.1016/j.ejmech.2020.113115 ]