6-(3,5-dimethylisoxazol-4-yl)-N-(4-methoxybenzyl)imidazo[1,2-a]pyridine-3-carboxamide

ID: ALA4871388

PubChem CID: 164621146

Max Phase: Preclinical

Molecular Formula: C21H20N4O3

Molecular Weight: 376.42

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNC(=O)c2cnc3ccc(-c4c(C)noc4C)cn23)cc1

Standard InChI:  InChI=1S/C21H20N4O3/c1-13-20(14(2)28-24-13)16-6-9-19-22-11-18(25(19)12-16)21(26)23-10-15-4-7-17(27-3)8-5-15/h4-9,11-12H,10H2,1-3H3,(H,23,26)

Standard InChI Key:  KEDYZKFHOIDRJI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   12.5505  -27.8054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5505  -28.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2626  -29.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2626  -27.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9747  -27.8054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9746  -28.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7559  -28.8808    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.2389  -28.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7559  -27.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8372  -27.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0109  -26.7670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8179  -26.5955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4589  -26.1539    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0729  -25.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8799  -25.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4301  -26.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2365  -26.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4921  -25.2982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9352  -24.6837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1310  -24.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2989  -25.1257    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.8517  -25.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7465  -26.5821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9415  -26.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.5320  -27.1264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0839  -27.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3572  -26.0275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9156  -28.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 18 21  1  0
 21 22  1  0
 10 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 10  2  0
 23 27  1  0
 26 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871388

    ---

Associated Targets(Human)

CLK1 Tchem Dual specificty protein kinase CLK1 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 376.42Molecular Weight (Monoisotopic): 376.1535AlogP: 3.54#Rotatable Bonds: 5
Polar Surface Area: 81.66Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.41CX LogP: 1.66CX LogD: 1.66
Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.58Np Likeness Score: -1.56

References

1. Zhang Y, Xia A, Zhang S, Lin G, Liu J, Chen P, Mu B, Jiao Y, Xu W, Chen M, Li L..  (2021)  Discovery of 3,6-disubstutited-imidazo[1,2-a]pyridine derivatives as a new class of CLK1 inhibitors.,  41  [PMID:33662541] [10.1016/j.bmcl.2021.127881]

Source