(2S,3R)-3-(3-boronopropyl)-2-(2-(piperidin-1-yl)ethyl)pyrrolidine-2-carboxylic acid

ID: ALA4871410

PubChem CID: 164620702

Max Phase: Preclinical

Molecular Formula: C15H29BN2O4

Molecular Weight: 312.22

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)[C@@]1(CCN2CCCCC2)NCC[C@H]1CCCB(O)O

Standard InChI:  InChI=1S/C15H29BN2O4/c19-14(20)15(7-12-18-10-2-1-3-11-18)13(6-9-17-15)5-4-8-16(21)22/h13,17,21-22H,1-12H2,(H,19,20)/t13-,15+/m1/s1

Standard InChI Key:  HXSRLJCBZDVBLE-HIFRSBDPSA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   21.4781  -16.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8908  -17.4169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2992  -16.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4863  -18.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3035  -18.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5579  -17.8990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2362  -17.8990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3354  -17.6476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9420  -18.1952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7195  -17.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3260  -18.4914    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   26.1036  -18.2400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1550  -19.2905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.1164  -16.7021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8885  -15.9981    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6609  -16.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2502  -16.0030    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6597  -15.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2525  -14.5926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4349  -14.5909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0263  -15.2997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4352  -16.0102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  2  1  0
  2  7  1  0
  7  4  1  0
  6  8  1  6
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 11 13  1  0
  3 14  1  0
  3 15  2  0
  1 16  1  0
 16 17  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4871410

    ---

Associated Targets(Human)

ARG1 Tchem Arginase-1 (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.22Molecular Weight (Monoisotopic): 312.2220AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Lu M, Zhang H, Li D, Childers M, Pu Q, Palte RL, Gathiaka S, Lyons TW, Palani A, Fan PW, Spacciapoli P, Miller JR, Cho H, Cheng M, Chakravarthy K, O'Neil J, Eangoor P, Beard A, Kim HY, Saurí J, Gunaydin H, Sloman DL, Siliphaivanh P, Cumming J, Fischer C..  (2021)  Structure-Based Discovery of Proline-Derived Arginase Inhibitors with Improved Oral Bioavailability for Immuno-Oncology.,  12  (9.0): [PMID:34527178] [10.1021/acsmedchemlett.1c00195]

Source