The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S,E)-1-fluoro-5-phenyl-1-(phenylsulfonyl)pent-1-en-3-ylamino)-1-oxo-3-phenylpropan-2-yl)-2,3-dihydrobenzo[b][1,4]dioxine-6-carboxamide ID: ALA4871417
PubChem CID: 164621156
Max Phase: Preclinical
Molecular Formula: C35H33FN2O6S
Molecular Weight: 628.72
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(N[C@@H](Cc1ccccc1)C(=O)N[C@H](/C=C(\F)S(=O)(=O)c1ccccc1)CCc1ccccc1)c1ccc2c(c1)OCCO2
Standard InChI: InChI=1S/C35H33FN2O6S/c36-33(45(41,42)29-14-8-3-9-15-29)24-28(18-16-25-10-4-1-5-11-25)37-35(40)30(22-26-12-6-2-7-13-26)38-34(39)27-17-19-31-32(23-27)44-21-20-43-31/h1-15,17,19,23-24,28,30H,16,18,20-22H2,(H,37,40)(H,38,39)/b33-24+/t28-,30-/m0/s1
Standard InChI Key: NPJYBJKLELDEDD-SARUODQOSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
45.0322 -24.5405 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.6236 -23.8306 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
44.2146 -24.5379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.9363 -23.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6481 -23.4220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.3599 -23.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9363 -24.6561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.3599 -24.6561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0718 -23.4220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7836 -23.8347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.4913 -23.4220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0718 -22.6007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.0718 -25.0688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0673 -25.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7783 -26.2997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4870 -25.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4844 -25.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7769 -24.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2032 -23.8347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9150 -23.4220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4913 -22.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7836 -22.1921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7836 -21.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4934 -20.9595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4938 -20.1390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7855 -19.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0713 -20.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0745 -20.9618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9140 -22.6007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
45.3294 -23.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0392 -23.8257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7445 -23.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.7404 -22.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0251 -22.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3228 -22.6049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2314 -23.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2320 -22.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5247 -22.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5276 -23.8362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8198 -23.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8181 -22.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1114 -22.2063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.4019 -22.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4035 -23.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1148 -23.8455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
4 7 2 0
6 8 1 6
6 9 1 0
9 10 1 0
10 11 1 0
9 12 2 0
8 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 2 1 0
11 21 1 1
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
20 29 1 0
2 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 2 0
37 38 1 0
38 41 2 0
40 39 2 0
39 36 1 0
4 36 1 0
40 41 1 0
40 45 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.72Molecular Weight (Monoisotopic): 628.2043AlogP: 5.20#Rotatable Bonds: 12Polar Surface Area: 110.80Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.51CX Basic pKa: ┄CX LogP: 6.32CX LogD: 6.32Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.22Np Likeness Score: -0.39
References 1. Jung S, Fuchs N, Johe P, Wagner A, Diehl E, Yuliani T, Zimmer C, Barthels F, Zimmermann RA, Klein P, Waigel W, Meyr J, Opatz T, Tenzer S, Distler U, Räder HJ, Kersten C, Engels B, Hellmich UA, Klein J, Schirmeister T.. (2021) Fluorovinylsulfones and -Sulfonates as Potent Covalent Reversible Inhibitors of the Trypanosomal Cysteine Protease Rhodesain: Structure-Activity Relationship, Inhibition Mechanism, Metabolism, and In Vivo Studies., 64 (16.0): [PMID:34378914 ] [10.1021/acs.jmedchem.1c01002 ]